EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H18O5 |
| Net Charge | 0 |
| Average Mass | 302.326 |
| Monoisotopic Mass | 302.11542 |
| SMILES | COc1c(O)c(C)c(OC)c2c1CCc1c(O)cccc1O2 |
| InChI | InChI=1S/C17H18O5/c1-9-14(19)16(21-3)11-8-7-10-12(18)5-4-6-13(10)22-17(11)15(9)20-2/h4-6,18-19H,7-8H2,1-3H3 |
| InChIKey | XVMLDDFWHNGJME-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bauhinia purpurea (ncbitaxon:3806) | root (BTO:0001188) | PubMed (17480099) |
| Roles Classification |
|---|
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. cyclooxygenase 2 inhibitor A cyclooxygenase inhibitor that interferes with the action of cyclooxygenase 2. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. antimycobacterial drug A drug used to treat or prevent infections caused by Mycobacteria, a genus of actinobacteria. Aerobic and nonmotile, members of the genus include the pathogens responsible for causing tuberculosis and leprosy. |
| Applications: | antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. anti-inflammatory agent Any compound that has anti-inflammatory effects. antimycobacterial drug A drug used to treat or prevent infections caused by Mycobacteria, a genus of actinobacteria. Aerobic and nonmotile, members of the genus include the pathogens responsible for causing tuberculosis and leprosy. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bauhinoxepin F (CHEBI:65470) has role anti-inflammatory agent (CHEBI:67079) |
| bauhinoxepin F (CHEBI:65470) has role antifungal agent (CHEBI:35718) |
| bauhinoxepin F (CHEBI:65470) has role antimalarial (CHEBI:38068) |
| bauhinoxepin F (CHEBI:65470) has role antimycobacterial drug (CHEBI:64912) |
| bauhinoxepin F (CHEBI:65470) has role cyclooxygenase 2 inhibitor (CHEBI:50629) |
| bauhinoxepin F (CHEBI:65470) has role metabolite (CHEBI:25212) |
| bauhinoxepin F (CHEBI:65470) is a aromatic ether (CHEBI:35618) |
| bauhinoxepin F (CHEBI:65470) is a dibenzooxepine (CHEBI:38926) |
| bauhinoxepin F (CHEBI:65470) is a polyphenol (CHEBI:26195) |
| IUPAC Name |
|---|
| 6,9-dimethoxy-7-methyl-10,11-dihydrodibenzo[b,f]oxepine-1,8-diol |
| Synonym | Source |
|---|---|
| 5,6-dihydro-3,7-dihydroxy-1,4-methoxy-2-methyldibenz[b,f]oxepin | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11175323 | Reaxys |
| Citations |
|---|