EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H9O4.Na |
| Net Charge | 0 |
| Average Mass | 240.190 |
| Monoisotopic Mass | 240.03985 |
| SMILES | O=C1C([O-])=C(CCO)C(=O)c2ccccc21.[Na+] |
| InChI | InChI=1S/C12H10O4.Na/c13-6-5-9-10(14)7-3-1-2-4-8(7)11(15)12(9)16;/h1-4,13,16H,5-6H2;/q;+1/p-1 |
| InChIKey | NNKGFBSOJQBFRK-UHFFFAOYSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Impatiens balsamina (ncbitaxon:63779) | aerial part (BTO:0001658) | PubMed (12033510) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. cyclooxygenase 2 inhibitor A cyclooxygenase inhibitor that interferes with the action of cyclooxygenase 2. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| balsaminolate (CHEBI:65464) has part 3-(2-hydroxyethyl)-1,4-dioxo-1,4-dihydronaphthalen-2-olate (CHEBI:71183) |
| balsaminolate (CHEBI:65464) has role cyclooxygenase 2 inhibitor (CHEBI:50629) |
| balsaminolate (CHEBI:65464) has role metabolite (CHEBI:25212) |
| balsaminolate (CHEBI:65464) is a organic sodium salt (CHEBI:38700) |
| IUPAC Name |
|---|
| sodium 3-(2-hydroxyethyl)-1,4-dioxo-1,4-dihydronaphthalen-2-olate |
| Synonym | Source |
|---|---|
| sodium 2-hydroxide-3-(2-hydroxyethyl)napthalene-1,4-dione | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9597370 | Reaxys |
| Citations |
|---|