EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H20O11 |
| Net Charge | 0 |
| Average Mass | 448.380 |
| Monoisotopic Mass | 448.10056 |
| SMILES | O=c1oc2cc(O)ccc2c(O)c1-c1ccc(O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)cc1O |
| InChI | InChI=1S/C21H20O11/c22-7-14-17(26)18(27)19(28)21(32-14)30-9-2-4-10(12(24)6-9)15-16(25)11-3-1-8(23)5-13(11)31-20(15)29/h1-6,14,17-19,21-28H,7H2/t14-,17-,18+,19-,21-/m1/s1 |
| InChIKey | OEZWCAHAQBRTTP-FKRBRYKNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Asphodelus microcarpus (IPNI:531525-1) | |||
| bulb (BTO:0000159) | PubMed (17253862) | ||
| root (BTO:0001188) | PubMed (17253862) |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| asphodelin A-4'-O-β-glucoside (CHEBI:65454) has functional parent asphodelin A (CHEBI:65453) |
| asphodelin A-4'-O-β-glucoside (CHEBI:65454) has role antibacterial agent (CHEBI:33282) |
| asphodelin A-4'-O-β-glucoside (CHEBI:65454) has role antifungal agent (CHEBI:35718) |
| asphodelin A-4'-O-β-glucoside (CHEBI:65454) has role metabolite (CHEBI:25212) |
| asphodelin A-4'-O-β-glucoside (CHEBI:65454) is a hydroxycoumarin (CHEBI:37912) |
| asphodelin A-4'-O-β-glucoside (CHEBI:65454) is a polyphenol (CHEBI:26195) |
| asphodelin A-4'-O-β-glucoside (CHEBI:65454) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| 4-(4,7-dihydroxy-2-oxo-2H-chromen-3-yl)-3-hydroxyphenyl β-D-glucopyranoside |
| Synonym | Source |
|---|---|
| 3-(2'-hydroxy-p-O-β-D-glucopyranosyloxyphenyl)-4,7-dihydroxy-2H-1-benzopyran-2-one | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11288781 | Reaxys |
| Citations |
|---|