EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H10O6 |
| Net Charge | 0 |
| Average Mass | 286.239 |
| Monoisotopic Mass | 286.04774 |
| SMILES | O=c1oc2cc(O)ccc2c(O)c1-c1ccc(O)cc1O |
| InChI | InChI=1S/C15H10O6/c16-7-1-3-9(11(18)5-7)13-14(19)10-4-2-8(17)6-12(10)21-15(13)20/h1-6,16-19H |
| InChIKey | OZOZCKVLUMXFGS-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Asphodelus microcarpus (IPNI:531525-1) | |||
| root (BTO:0001188) | PubMed (17253862) | ||
| bulb (BTO:0000159) | PubMed (17253862) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| asphodelin A (CHEBI:65453) has role antibacterial agent (CHEBI:33282) |
| asphodelin A (CHEBI:65453) has role antifungal agent (CHEBI:35718) |
| asphodelin A (CHEBI:65453) has role metabolite (CHEBI:25212) |
| asphodelin A (CHEBI:65453) is a hydroxycoumarin (CHEBI:37912) |
| asphodelin A (CHEBI:65453) is a polyphenol (CHEBI:26195) |
| Incoming Relation(s) |
| asphodelin A-4'-O-β-glucoside (CHEBI:65454) has functional parent asphodelin A (CHEBI:65453) |
| IUPAC Name |
|---|
| 3-(2,4-dihydroxyphenyl)-4,7-dihydroxy-2H-chromen-2-one |
| Synonym | Source |
|---|---|
| 3-(2',4'-dihydroxyphenyl)-4,7-dihydroxy-2H-1-benzopyran-2-one | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11288782 | Reaxys |
| Citations |
|---|