EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H26O7 |
| Net Charge | 0 |
| Average Mass | 414.454 |
| Monoisotopic Mass | 414.16785 |
| SMILES | COc1c([C@H](CC(C)C)OC(C)=O)ccc2c1C(=O)OCc1cc(C)cc(O)c1O2 |
| InChI | InChI=1S/C23H26O7/c1-12(2)8-19(29-14(4)24)16-6-7-18-20(22(16)27-5)23(26)28-11-15-9-13(3)10-17(25)21(15)30-18/h6-7,9-10,12,19,25H,8,11H2,1-5H3/t19-/m0/s1 |
| InChIKey | NUYFKDBCHFKOBT-IBGZPJMESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium purpurogenum (ncbitaxon:28575) | - | PubMed (2010354) | Strain: FO 6081 |
| Roles Classification |
|---|
| Biological Roles: | EC 2.3.1.26 (sterol O-acyltransferase) inhibitor An EC 2.3.1.* (acyltransferase transferring other than amino-acyl group) inhibitor that interferes with the action of acyl-CoA:cholesterol acyltransferase (EC 2.3.1.26). antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. Penicillium metabolite Any fungal metabolite produced during a metabolic reaction in Penicillium. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| AS-186b (CHEBI:65444) has functional parent AS-186a (CHEBI:65443) |
| AS-186b (CHEBI:65444) has role Penicillium metabolite (CHEBI:76964) |
| AS-186b (CHEBI:65444) has role antimicrobial agent (CHEBI:33281) |
| AS-186b (CHEBI:65444) has role EC 2.3.1.26 (sterol O-acyltransferase) inhibitor (CHEBI:64696) |
| AS-186b (CHEBI:65444) is a acetate ester (CHEBI:47622) |
| AS-186b (CHEBI:65444) is a aromatic ether (CHEBI:35618) |
| AS-186b (CHEBI:65444) is a dibenzodioxocine (CHEBI:71064) |
| AS-186b (CHEBI:65444) is a lactone (CHEBI:25000) |
| AS-186b (CHEBI:65444) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| (1S)-1-(11-hydroxy-4-methoxy-9-methyl-5-oxo-5H,7H-dibenzo[b,g][1,5]dioxocin-3-yl)-3-methylbutyl acetate |
| Synonyms | Source |
|---|---|
| 1'-O-acetylpenicillide | ChEBI |
| Purpactin A | ChemIDplus |
| vermixocin B | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:18624666 | Reaxys |
| CAS:133806-59-4 | ChemIDplus |
| Citations |
|---|