EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H24O6 |
| Net Charge | 0 |
| Average Mass | 372.417 |
| Monoisotopic Mass | 372.15729 |
| SMILES | COc1c([C@@H](O)CC(C)C)ccc2c1C(=O)OCc1cc(C)cc(O)c1O2 |
| InChI | InChI=1S/C21H24O6/c1-11(2)7-15(22)14-5-6-17-18(20(14)25-4)21(24)26-10-13-8-12(3)9-16(23)19(13)27-17/h5-6,8-9,11,15,22-23H,7,10H2,1-4H3/t15-/m0/s1 |
| InChIKey | UOWGLBYIKHMCIS-HNNXBMFYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium asperosporum (ncbitaxon:70097) | - | DOI (10.1016/S0040-4039(01)92051-9) | Strain: KY 1635 |
| Roles Classification |
|---|
| Biological Roles: | EC 2.3.1.26 (sterol O-acyltransferase) inhibitor An EC 2.3.1.* (acyltransferase transferring other than amino-acyl group) inhibitor that interferes with the action of acyl-CoA:cholesterol acyltransferase (EC 2.3.1.26). Penicillium metabolite Any fungal metabolite produced during a metabolic reaction in Penicillium. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| AS-186a (CHEBI:65443) has role Penicillium metabolite (CHEBI:76964) |
| AS-186a (CHEBI:65443) has role antimicrobial agent (CHEBI:33281) |
| AS-186a (CHEBI:65443) has role EC 2.3.1.26 (sterol O-acyltransferase) inhibitor (CHEBI:64696) |
| AS-186a (CHEBI:65443) is a aromatic ether (CHEBI:35618) |
| AS-186a (CHEBI:65443) is a dibenzodioxocine (CHEBI:71064) |
| AS-186a (CHEBI:65443) is a lactone (CHEBI:25000) |
| AS-186a (CHEBI:65443) is a phenols (CHEBI:33853) |
| AS-186a (CHEBI:65443) is a secondary alcohol (CHEBI:35681) |
| Incoming Relation(s) |
| AS-186b (CHEBI:65444) has functional parent AS-186a (CHEBI:65443) |
| IUPAC Name |
|---|
| 11-hydroxy-3-[(1S)-1-hydroxy-3-methylbutyl]-4-methoxy-9-methyl-5H,7H-dibenzo[b,g][1,5]dioxocin-5-one |
| Synonyms | Source |
|---|---|
| penicillide | ChEBI |
| vermixocin A | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4767683 | Reaxys |
| Citations |
|---|