EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:6541 - losartan
| Formula | C22H23ClN6O |
| Net Charge | 0 |
| Average Mass | 422.920 |
| Monoisotopic Mass | 422.16219 |
| SMILES | CCCCc1nc(Cl)c(CO)n1Cc1ccc(-c2ccccc2-c2nnnn2)cc1 |
| InChI | InChI=1S/C22H23ClN6O/c1-2-3-8-20-24-21(23)19(14-30)29(20)13-15-9-11-16(12-10-15)17-6-4-5-7-18(17)22-25-27-28-26-22/h4-7,9-12,30H,2-3,8,13-14H2,1H3,(H,25,26,27,28) |
| InChIKey | PSIFNNKUMBGKDQ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | angiotensin receptor antagonist A hormone antagonist that blocks angiotensin receptors. endothelin receptor antagonist A hormone antagonist that blocks endothelin receptors. |
| Applications: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. angiotensin receptor antagonist A hormone antagonist that blocks angiotensin receptors. anti-arrhythmia drug A drug used for the treatment or prevention of cardiac arrhythmias. Anti-arrhythmia drugs may affect the polarisation-repolarisation phase of the action potential, its excitability or refractoriness, or impulse conduction or membrane responsiveness within cardiac fibres. endothelin receptor antagonist A hormone antagonist that blocks endothelin receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| losartan (CHEBI:6541) has role angiotensin receptor antagonist (CHEBI:61016) |
| losartan (CHEBI:6541) has role anti-arrhythmia drug (CHEBI:38070) |
| losartan (CHEBI:6541) has role antihypertensive agent (CHEBI:35674) |
| losartan (CHEBI:6541) has role endothelin receptor antagonist (CHEBI:51451) |
| losartan (CHEBI:6541) is a biphenylyltetrazole (CHEBI:48420) |
| losartan (CHEBI:6541) is a imidazoles (CHEBI:24780) |
| losartan (CHEBI:6541) is conjugate acid of losartan(1−) (CHEBI:149504) |
| Incoming Relation(s) |
| losartan carboxylic acid (CHEBI:74125) has functional parent losartan (CHEBI:6541) |
| losartan(1−) (CHEBI:149504) is conjugate base of losartan (CHEBI:6541) |
| IUPAC Name |
|---|
| (2-butyl-4-chloro-1-{[2'-(1H-tetrazol-5-yl)[1,1'-biphenyl]-4-yl]methyl}-1H-imidazol-5-yl)methanol |
| INN | Source |
|---|---|
| losartan | ChemIDplus |
| Synonyms | Source |
|---|---|
| (2-butyl-4-chloro-1-{[2'-(1H-tetrazol-5-yl)biphenyl-4-yl]methyl}-1H-imidazol-5-yl)methanol | IUPAC |
| 2-n-butyl-4-chloro-5-hydroxymethyl-1-[(2'-(1H-tetrazol-5-yl)biphenyl-4-yl)methyl]imidazole | IUPHAR |
| Losartan | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4770867 | Reaxys |
| CAS:114798-26-4 | KEGG COMPOUND |
| CAS:114798-26-4 | ChemIDplus |
| Citations |
|---|