EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H23ClN6O |
| Net Charge | 0 |
| Average Mass | 422.920 |
| Monoisotopic Mass | 422.16219 |
| SMILES | CCCCc1nc(Cl)c(CO)n1Cc1ccc(-c2ccccc2-c2nnnn2)cc1 |
| InChI | InChI=1S/C22H23ClN6O/c1-2-3-8-20-24-21(23)19(14-30)29(20)13-15-9-11-16(12-10-15)17-6-4-5-7-18(17)22-25-27-28-26-22/h4-7,9-12,30H,2-3,8,13-14H2,1H3,(H,25,26,27,28) |
| InChIKey | PSIFNNKUMBGKDQ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | angiotensin receptor antagonist A hormone antagonist that blocks angiotensin receptors. endothelin receptor antagonist A hormone antagonist that blocks endothelin receptors. |
| Applications: | angiotensin receptor antagonist A hormone antagonist that blocks angiotensin receptors. anti-arrhythmia drug A drug used for the treatment or prevention of cardiac arrhythmias. Anti-arrhythmia drugs may affect the polarisation-repolarisation phase of the action potential, its excitability or refractoriness, or impulse conduction or membrane responsiveness within cardiac fibres. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. endothelin receptor antagonist A hormone antagonist that blocks endothelin receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| losartan (CHEBI:6541) has role angiotensin receptor antagonist (CHEBI:61016) |
| losartan (CHEBI:6541) has role anti-arrhythmia drug (CHEBI:38070) |
| losartan (CHEBI:6541) has role antihypertensive agent (CHEBI:35674) |
| losartan (CHEBI:6541) has role endothelin receptor antagonist (CHEBI:51451) |
| losartan (CHEBI:6541) is a biphenylyltetrazole (CHEBI:48420) |
| losartan (CHEBI:6541) is a imidazoles (CHEBI:24780) |
| losartan (CHEBI:6541) is conjugate acid of losartan(1−) (CHEBI:149504) |
| Incoming Relation(s) |
| losartan carboxylic acid (CHEBI:74125) has functional parent losartan (CHEBI:6541) |
| losartan(1−) (CHEBI:149504) is conjugate base of losartan (CHEBI:6541) |
| IUPAC Name |
|---|
| (2-butyl-4-chloro-1-{[2'-(1H-tetrazol-5-yl)[1,1'-biphenyl]-4-yl]methyl}-1H-imidazol-5-yl)methanol |
| INN | Source |
|---|---|
| losartan | ChemIDplus |
| Synonyms | Source |
|---|---|
| (2-butyl-4-chloro-1-{[2'-(1H-tetrazol-5-yl)biphenyl-4-yl]methyl}-1H-imidazol-5-yl)methanol | IUPAC |
| 2-n-butyl-4-chloro-5-hydroxymethyl-1-[(2'-(1H-tetrazol-5-yl)biphenyl-4-yl)methyl]imidazole | IUPHAR |
| Losartan | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4770867 | Reaxys |
| CAS:114798-26-4 | KEGG COMPOUND |
| CAS:114798-26-4 | ChemIDplus |
| Citations |
|---|