EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H23ClN2O2 |
| Net Charge | 0 |
| Average Mass | 382.891 |
| Monoisotopic Mass | 382.14481 |
| SMILES | CCOC(=O)N1CCC(=C2c3ccc(Cl)cc3CCc3cccnc32)CC1 |
| InChI | InChI=1S/C22H23ClN2O2/c1-2-27-22(26)25-12-9-15(10-13-25)20-19-8-7-18(23)14-17(19)6-5-16-4-3-11-24-21(16)20/h3-4,7-8,11,14H,2,5-6,9-10,12-13H2,1H3 |
| InChIKey | JCCNYMKQOSZNPW-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. cholinergic antagonist Any drug that binds to but does not activate cholinergic receptors, thereby blocking the actions of acetylcholine or cholinergic agonists. |
| Applications: | anti-allergic agent A drug used to treat allergic reactions. H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. cholinergic antagonist Any drug that binds to but does not activate cholinergic receptors, thereby blocking the actions of acetylcholine or cholinergic agonists. geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| loratadine (CHEBI:6538) has functional parent desloratadine (CHEBI:291342) |
| loratadine (CHEBI:6538) has role anti-allergic agent (CHEBI:50857) |
| loratadine (CHEBI:6538) has role cholinergic antagonist (CHEBI:48873) |
| loratadine (CHEBI:6538) has role geroprotector (CHEBI:176497) |
| loratadine (CHEBI:6538) has role H1-receptor antagonist (CHEBI:37955) |
| loratadine (CHEBI:6538) is a N-acylpiperidine (CHEBI:48591) |
| loratadine (CHEBI:6538) is a benzocycloheptapyridine (CHEBI:48593) |
| loratadine (CHEBI:6538) is a ethyl ester (CHEBI:23990) |
| loratadine (CHEBI:6538) is a organochlorine compound (CHEBI:36683) |
| loratadine (CHEBI:6538) is a tertiary carboxamide (CHEBI:140326) |
| IUPAC Name |
|---|
| ethyl 4-(8-chloro-5,6-dihydro-11H-benzo[5,6]cyclohepta[1,2-b]pyridin-11-ylidene)piperidine-1-carboxylate |
| INNs | Source |
|---|---|
| loratadine | WHO MedNet |
| loratadine | WHO MedNet |
| loratadinum | WHO MedNet |
| loratadina | WHO MedNet |
| Synonym | Source |
|---|---|
| 4-(8-chloro-5,6-dihydro-11H-benzo[5,6]cyclohepta[1,2-b]pyridin-11-ylidene)-1-piperidinecarboxylic acid ethyl ester | ChEBI |
| Brand Names | Source |
|---|---|
| Claritin | KEGG DRUG |
| Loracert | ChemIDplus |
| Lorastine | ChemIDplus |
| Loradex | ChemIDplus |
| Loradamed | DrugBank |
| Allerclear | DrugBank |
| Manual Xrefs | Databases |
|---|---|
| D00364 | KEGG DRUG |
| LSM-5891 | LINCS |
| 1605 | DrugCentral |
| HMDB0005000 | HMDB |
| 3820 | ChemSpider |
| DB00455 | DrugBank |
| FDB023577 | FooDB |
| Loratadine | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4273483 | Reaxys |
| CAS:79794-75-5 | KEGG COMPOUND |
| CAS:79794-75-5 | ChemIDplus |
| Citations |
|---|