EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H23ClN2O2 |
| Net Charge | 0 |
| Average Mass | 382.891 |
| Monoisotopic Mass | 382.14481 |
| SMILES | CCOC(=O)N1CCC(=C2c3ccc(Cl)cc3CCc3cccnc32)CC1 |
| InChI | InChI=1S/C22H23ClN2O2/c1-2-27-22(26)25-12-9-15(10-13-25)20-19-8-7-18(23)14-17(19)6-5-16-4-3-11-24-21(16)20/h3-4,7-8,11,14H,2,5-6,9-10,12-13H2,1H3 |
| InChIKey | JCCNYMKQOSZNPW-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | cholinergic antagonist Any drug that binds to but does not activate cholinergic receptors, thereby blocking the actions of acetylcholine or cholinergic agonists. H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. |
| Applications: | cholinergic antagonist Any drug that binds to but does not activate cholinergic receptors, thereby blocking the actions of acetylcholine or cholinergic agonists. H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. anti-allergic agent A drug used to treat allergic reactions. geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| loratadine (CHEBI:6538) has functional parent desloratadine (CHEBI:291342) |
| loratadine (CHEBI:6538) has role anti-allergic agent (CHEBI:50857) |
| loratadine (CHEBI:6538) has role cholinergic antagonist (CHEBI:48873) |
| loratadine (CHEBI:6538) has role geroprotector (CHEBI:176497) |
| loratadine (CHEBI:6538) has role H1-receptor antagonist (CHEBI:37955) |
| loratadine (CHEBI:6538) is a N-acylpiperidine (CHEBI:48591) |
| loratadine (CHEBI:6538) is a benzocycloheptapyridine (CHEBI:48593) |
| loratadine (CHEBI:6538) is a ethyl ester (CHEBI:23990) |
| loratadine (CHEBI:6538) is a organochlorine compound (CHEBI:36683) |
| loratadine (CHEBI:6538) is a tertiary carboxamide (CHEBI:140326) |
| IUPAC Name |
|---|
| ethyl 4-(8-chloro-5,6-dihydro-11H-benzo[5,6]cyclohepta[1,2-b]pyridin-11-ylidene)piperidine-1-carboxylate |
| INNs | Source |
|---|---|
| loratadina | WHO MedNet |
| loratadine | WHO MedNet |
| loratadine | WHO MedNet |
| loratadinum | WHO MedNet |
| Synonym | Source |
|---|---|
| 4-(8-chloro-5,6-dihydro-11H-benzo[5,6]cyclohepta[1,2-b]pyridin-11-ylidene)-1-piperidinecarboxylic acid ethyl ester | ChEBI |
| Brand Names | Source |
|---|---|
| Aerotina | ChemIDplus |
| Alarin | ChemIDplus |
| Alavert | DrugBank |
| Alerpriv | ChemIDplus |
| Allerclear | DrugBank |
| Civerán | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 1605 | DrugCentral |
| 3820 | ChemSpider |
| D00364 | KEGG DRUG |
| DB00455 | DrugBank |
| FDB023577 | FooDB |
| HMDB0005000 | HMDB |
| Loratadine | Wikipedia |
| LSM-5891 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4273483 | Reaxys |
| CAS:79794-75-5 | ChemIDplus |
| CAS:79794-75-5 | KEGG COMPOUND |
| Citations |
|---|