EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H19ClN2 |
| Net Charge | 0 |
| Average Mass | 310.828 |
| Monoisotopic Mass | 310.12368 |
| SMILES | Clc1ccc2c(c1)CCc1cccnc1C2=C1CCNCC1 |
| InChI | InChI=1S/C19H19ClN2/c20-16-5-6-17-15(12-16)4-3-14-2-1-9-22-19(14)18(17)13-7-10-21-11-8-13/h1-2,5-6,9,12,21H,3-4,7-8,10-11H2 |
| InChIKey | JAUOIFJMECXRGI-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | cholinergic antagonist Any drug that binds to but does not activate cholinergic receptors, thereby blocking the actions of acetylcholine or cholinergic agonists. H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. |
| Applications: | anti-allergic agent A drug used to treat allergic reactions. cholinergic antagonist Any drug that binds to but does not activate cholinergic receptors, thereby blocking the actions of acetylcholine or cholinergic agonists. H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| desloratadine (CHEBI:291342) has role anti-allergic agent (CHEBI:50857) |
| desloratadine (CHEBI:291342) has role cholinergic antagonist (CHEBI:48873) |
| desloratadine (CHEBI:291342) has role drug metabolite (CHEBI:49103) |
| desloratadine (CHEBI:291342) has role H1-receptor antagonist (CHEBI:37955) |
| desloratadine (CHEBI:291342) is a benzocycloheptapyridine (CHEBI:48593) |
| Incoming Relation(s) |
| loratadine (CHEBI:6538) has functional parent desloratadine (CHEBI:291342) |
| IUPAC Name |
|---|
| 8-chloro-11-(piperidin-4-ylidene)-6,11-dihydro-5H-benzo[5,6]cyclohepta[1,2-b]pyridine |
| INN | Source |
|---|---|
| desloratadine | KEGG DRUG |
| Synonyms | Source |
|---|---|
| 8-Chloro-11-piperidin-4-ylidene-6,11-dihydro-5H-benzo[5,6]cyclohepta[1,2-b]pyridine | ChEMBL |
| 8-chloro-6,11-dihydro-11-(4-piperidinylidene)-5H-benzo(5,6)cyclohepta(1,2-b)pyridine | ChemIDplus |
| descarboethoxyloratadine | ChemIDplus |
| DESLORATADINE | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| Beilstein:4263164 | Beilstein |
| CAS:100643-71-8 | KEGG DRUG |
| CAS:100643-71-8 | ChemIDplus |
| Citations |
|---|