EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C48H50O22 |
| Net Charge | 0 |
| Average Mass | 978.906 |
| Monoisotopic Mass | 978.27937 |
| SMILES | [H][C@@]1(O[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H](Oc2cc3c(c(C)c2C(=O)O)C(=O)c2c(ccc(C)c2O)[C@@]3(C)OO[C@@]2(C)c3cc(O)c(C(=O)O)c(C)c3C(=O)c3c2ccc(C)c3O)O[C@@H]1CO |
| InChI | InChI=1S/C48H50O22/c1-15-7-9-19-31(33(15)52)36(55)27-17(3)29(43(61)62)23(51)11-21(27)47(19,5)69-70-48(6)20-10-8-16(2)34(53)32(20)37(56)28-18(4)30(44(63)64)24(12-22(28)48)65-45-41(60)39(58)42(26(14-50)67-45)68-46-40(59)38(57)35(54)25(13-49)66-46/h7-12,25-26,35,38-42,45-46,49-54,57-60H,13-14H2,1-6H3,(H,61,62)(H,63,64)/t25-,26-,35+,38+,39-,40-,41-,42+,45+,46-,47-,48-/m1/s1 |
| InChIKey | MVIOXXHCLPZAAQ-UMLDZSFSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces sp. (ncbitaxon:1931) | - | PubMed (10344578) | Strain: NA 148 |
| Roles Classification |
|---|
| Chemical Roles: | oxidising agent A substance that removes electrons from another reactant in a redox reaction. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| adxanthromycin B (CHEBI:65372) has role antimicrobial agent (CHEBI:33281) |
| adxanthromycin B (CHEBI:65372) has role metabolite (CHEBI:25212) |
| adxanthromycin B (CHEBI:65372) is a anthracenes (CHEBI:46955) |
| adxanthromycin B (CHEBI:65372) is a dicarboxylic acid (CHEBI:35692) |
| adxanthromycin B (CHEBI:65372) is a disaccharide derivative (CHEBI:63353) |
| adxanthromycin B (CHEBI:65372) is a glycoside (CHEBI:24400) |
| adxanthromycin B (CHEBI:65372) is a organic peroxide (CHEBI:25702) |
| adxanthromycin B (CHEBI:65372) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| (10S)-10-{[(9S)-3-carboxy-2,5-dihydroxy-4,6,9-trimethyl-10-oxo-9,10-dihydroanthracen-9-yl]peroxy}-3-{[4-O-(α-D-galactopyranosyl)-α-D-galactopyranosyl]oxy}-8-hydroxy-1,7,10-trimethyl-9-oxo-9,10-dihydroanthracene-2-carboxylic acid |
| Citations |
|---|