EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H30NO4S2 |
| Net Charge | +1 |
| Average Mass | 484.663 |
| Monoisotopic Mass | 484.16108 |
| SMILES | O=C(O[C@H]1C[N+]2(CCCOc3ccccc3)CCC1CC2)C(O)(c1cccs1)c1cccs1 |
| InChI | InChI=1S/C26H30NO4S2/c28-25(26(29,23-9-4-17-32-23)24-10-5-18-33-24)31-22-19-27(14-11-20(22)12-15-27)13-6-16-30-21-7-2-1-3-8-21/h1-5,7-10,17-18,20,22,29H,6,11-16,19H2/q+1/t20?,22-,27?/m0/s1 |
| InChIKey | ASMXXROZKSBQIH-VITNCHFBSA-N |
| Roles Classification |
|---|
| Biological Role: | muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. |
| Applications: | muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. bronchodilator agent An agent that causes an increase in the expansion of a bronchus or bronchial tubes. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aclidinium (CHEBI:65346) has functional parent 3-quinuclidinol (CHEBI:115239) |
| aclidinium (CHEBI:65346) has role bronchodilator agent (CHEBI:35523) |
| aclidinium (CHEBI:65346) has role muscarinic antagonist (CHEBI:48876) |
| aclidinium (CHEBI:65346) is a aromatic ether (CHEBI:35618) |
| aclidinium (CHEBI:65346) is a carboxylic ester (CHEBI:33308) |
| aclidinium (CHEBI:65346) is a quaternary ammonium ion (CHEBI:35267) |
| aclidinium (CHEBI:65346) is a thiophenes (CHEBI:26961) |
| Incoming Relation(s) |
| aclidinium bromide (CHEBI:65344) has part aclidinium (CHEBI:65346) |
| IUPAC Name |
|---|
| (3R)-3-[2-hydroxy(di-2-thienyl)acetoxy]-1-(3-phenoxypropyl)-1-azoniabicyclo[2.2.2]octane |
| Synonyms | Source |
|---|---|
| Aclidinium cation | ChEMBL |
| Aclidinium ion | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 4484 | DrugCentral |
| Citations |
|---|