EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H30NO4S2 |
| Net Charge | +1 |
| Average Mass | 484.663 |
| Monoisotopic Mass | 484.16108 |
| SMILES | O=C(O[C@H]1C[N+]2(CCCOc3ccccc3)CCC1CC2)C(O)(c1cccs1)c1cccs1 |
| InChI | InChI=1S/C26H30NO4S2/c28-25(26(29,23-9-4-17-32-23)24-10-5-18-33-24)31-22-19-27(14-11-20(22)12-15-27)13-6-16-30-21-7-2-1-3-8-21/h1-5,7-10,17-18,20,22,29H,6,11-16,19H2/q+1/t20?,22-,27?/m0/s1 |
| InChIKey | ASMXXROZKSBQIH-VITNCHFBSA-N |
| Roles Classification |
|---|
| Biological Role: | muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. |
| Applications: | bronchodilator agent An agent that causes an increase in the expansion of a bronchus or bronchial tubes. muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aclidinium (CHEBI:65346) has functional parent 3-quinuclidinol (CHEBI:115239) |
| aclidinium (CHEBI:65346) has role bronchodilator agent (CHEBI:35523) |
| aclidinium (CHEBI:65346) has role muscarinic antagonist (CHEBI:48876) |
| aclidinium (CHEBI:65346) is a aromatic ether (CHEBI:35618) |
| aclidinium (CHEBI:65346) is a carboxylic ester (CHEBI:33308) |
| aclidinium (CHEBI:65346) is a quaternary ammonium ion (CHEBI:35267) |
| aclidinium (CHEBI:65346) is a thiophenes (CHEBI:26961) |
| Incoming Relation(s) |
| aclidinium bromide (CHEBI:65344) has part aclidinium (CHEBI:65346) |
| IUPAC Name |
|---|
| (3R)-3-[2-hydroxy(di-2-thienyl)acetoxy]-1-(3-phenoxypropyl)-1-azoniabicyclo[2.2.2]octane |
| Synonyms | Source |
|---|---|
| Aclidinium cation | ChEMBL |
| Aclidinium ion | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 4484 | DrugCentral |
| Citations |
|---|