EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | Br.C26H30NO4S2 |
| Net Charge | 0 |
| Average Mass | 564.567 |
| Monoisotopic Mass | 563.07996 |
| SMILES | O=C(O[C@H]1C[N+]2(CCCOc3ccccc3)CCC1CC2)C(O)(c1cccs1)c1cccs1.[Br-] |
| InChI | InChI=1S/C26H30NO4S2.BrH/c28-25(26(29,23-9-4-17-32-23)24-10-5-18-33-24)31-22-19-27(14-11-20(22)12-15-27)13-6-16-30-21-7-2-1-3-8-21;/h1-5,7-10,17-18,20,22,29H,6,11-16,19H2;1H/q+1;/p-1/t20?,22-,27?;/m0./s1 |
| InChIKey | XLAKJQPTOJHYDR-QTQXQZBYSA-M |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. |
| Applications: | muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. bronchodilator agent An agent that causes an increase in the expansion of a bronchus or bronchial tubes. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aclidinium bromide (CHEBI:65344) has part aclidinium (CHEBI:65346) |
| aclidinium bromide (CHEBI:65344) has role bronchodilator agent (CHEBI:35523) |
| aclidinium bromide (CHEBI:65344) has role muscarinic antagonist (CHEBI:48876) |
| aclidinium bromide (CHEBI:65344) is a organic bromide salt (CHEBI:48369) |
| aclidinium bromide (CHEBI:65344) is a quaternary ammonium salt (CHEBI:35273) |
| IUPAC Name |
|---|
| (3R)-3-[2-hydroxy(di-2-thienyl)acetoxy]-1-(3-phenoxypropyl)-1-azoniabicyclo[2.2.2]octane bromide |
| INN | Source |
|---|---|
| aclidinium bromide | KEGG DRUG |
| Synonym | Source |
|---|---|
| LAS 34273 | ChemIDplus |
| Brand Name | Source |
|---|---|
| Tudorza Pressair | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| Aclidinium_bromide | Wikipedia |
| D08837 | KEGG DRUG |
| US2005267078 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11340576 | Reaxys |
| CAS:320345-99-1 | ChemIDplus |
| Citations |
|---|