EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | Br.C26H30NO4S2 |
| Net Charge | 0 |
| Average Mass | 564.567 |
| Monoisotopic Mass | 563.07996 |
| SMILES | O=C(O[C@H]1C[N+]2(CCCOc3ccccc3)CCC1CC2)C(O)(c1cccs1)c1cccs1.[Br-] |
| InChI | InChI=1S/C26H30NO4S2.BrH/c28-25(26(29,23-9-4-17-32-23)24-10-5-18-33-24)31-22-19-27(14-11-20(22)12-15-27)13-6-16-30-21-7-2-1-3-8-21;/h1-5,7-10,17-18,20,22,29H,6,11-16,19H2;1H/q+1;/p-1/t20?,22-,27?;/m0./s1 |
| InChIKey | XLAKJQPTOJHYDR-QTQXQZBYSA-M |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. |
| Applications: | antispasmodic drug A drug that suppresses spasms. These are usually caused by smooth muscle contraction, especially in tubular organs. The effect is to prevent spasms of the stomach, intestine or urinary bladder. bronchodilator agent An agent that causes an increase in the expansion of a bronchus or bronchial tubes. muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aclidinium bromide (CHEBI:65344) has part aclidinium (CHEBI:65346) |
| aclidinium bromide (CHEBI:65344) has role antispasmodic drug (CHEBI:53784) |
| aclidinium bromide (CHEBI:65344) has role bronchodilator agent (CHEBI:35523) |
| aclidinium bromide (CHEBI:65344) has role muscarinic antagonist (CHEBI:48876) |
| aclidinium bromide (CHEBI:65344) is a organic bromide salt (CHEBI:48369) |
| aclidinium bromide (CHEBI:65344) is a quaternary ammonium salt (CHEBI:35273) |
| IUPAC Name |
|---|
| (3R)-3-[2-hydroxy(di-2-thienyl)acetoxy]-1-(3-phenoxypropyl)-1-azoniabicyclo[2.2.2]octane bromide |
| INNs | Source |
|---|---|
| aclidinium bromide | KEGG DRUG |
| bromure d'aclidinium | WHO MedNet |
| bromuro de aclidinio | WHO MedNet |
| Synonyms | Source |
|---|---|
| 14115700 | ChEMBL |
| Genuair | ChEMBL |
| LAS 34273 | ChemIDplus |
| LAS-34273 | ChEMBL |
| LAS34273 | ChEMBL |
| LAS 34273 MICRONIZED | ChEMBL |
| Brand Names | Source |
|---|---|
| Aclidinium bromide component of duaklir pressair | ChEMBL |
| Bretaris genuair | ChEMBL |
| Eklira | ChEMBL |
| Eklira genuair | ChEMBL |
| Tudorza Pressair | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| Aclidinium_bromide | Wikipedia |
| D08837 | KEGG DRUG |
| US2005267078 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11340576 | Reaxys |
| CAS:320345-99-1 | ChemIDplus |
| Citations |
|---|