EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | Br.C26H30NO4S2 |
| Net Charge | 0 |
| Average Mass | 564.567 |
| Monoisotopic Mass | 563.07996 |
| SMILES | O=C(O[C@H]1C[N+]2(CCCOc3ccccc3)CCC1CC2)C(O)(c1cccs1)c1cccs1.[Br-] |
| InChI | InChI=1S/C26H30NO4S2.BrH/c28-25(26(29,23-9-4-17-32-23)24-10-5-18-33-24)31-22-19-27(14-11-20(22)12-15-27)13-6-16-30-21-7-2-1-3-8-21;/h1-5,7-10,17-18,20,22,29H,6,11-16,19H2;1H/q+1;/p-1/t20?,22-,27?;/m0./s1 |
| InChIKey | XLAKJQPTOJHYDR-QTQXQZBYSA-M |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. |
| Applications: | bronchodilator agent An agent that causes an increase in the expansion of a bronchus or bronchial tubes. muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aclidinium bromide (CHEBI:65344) has part aclidinium (CHEBI:65346) |
| aclidinium bromide (CHEBI:65344) has role bronchodilator agent (CHEBI:35523) |
| aclidinium bromide (CHEBI:65344) has role muscarinic antagonist (CHEBI:48876) |
| aclidinium bromide (CHEBI:65344) is a organic bromide salt (CHEBI:48369) |
| aclidinium bromide (CHEBI:65344) is a quaternary ammonium salt (CHEBI:35273) |
| IUPAC Name |
|---|
| (3R)-3-[2-hydroxy(di-2-thienyl)acetoxy]-1-(3-phenoxypropyl)-1-azoniabicyclo[2.2.2]octane bromide |
| INN | Source |
|---|---|
| aclidinium bromide | KEGG DRUG |
| Synonym | Source |
|---|---|
| LAS 34273 | ChemIDplus |
| Brand Name | Source |
|---|---|
| Tudorza Pressair | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| Aclidinium_bromide | Wikipedia |
| D08837 | KEGG DRUG |
| US2005267078 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11340576 | Reaxys |
| CAS:320345-99-1 | ChemIDplus |
| Citations |
|---|