EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H35NO8 |
| Net Charge | 0 |
| Average Mass | 525.598 |
| Monoisotopic Mass | 525.23627 |
| SMILES | [H][C@@]12CCC(=O)[C@@]1(C)C[C@@H](OC(C)=O)C1=C2C(=O)C(O)=C2/C(=C\N(CC=C)CC=C)C(=O)O[C@H](COC)[C@@]21C |
| InChI | InChI=1S/C29H35NO8/c1-7-11-30(12-8-2)14-17-23-26(34)25(33)22-18-9-10-20(32)28(18,4)13-19(37-16(3)31)24(22)29(23,5)21(15-36-6)38-27(17)35/h7-8,14,18-19,21,34H,1-2,9-13,15H2,3-6H3/b17-14+/t18-,19+,21+,28-,29-/m0/s1 |
| InChIKey | QIUASFSNWYMDFS-NILGECQDSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | EC 2.7.1.137 (phosphatidylinositol 3-kinase) inhibitor An inhibitor of phosphatidylinositol 3-kinase, EC 2.7.1.137, a family of related enzymes capable of phosphorylating the 3 position hydroxy group of the inositol ring of a phosphatidylinositol. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| PX-866 (CHEBI:65345) has functional parent wortmannin (CHEBI:52289) |
| PX-866 (CHEBI:65345) has role EC 2.7.1.137 (phosphatidylinositol 3-kinase) inhibitor (CHEBI:50914) |
| PX-866 (CHEBI:65345) is a acetate ester (CHEBI:47622) |
| PX-866 (CHEBI:65345) is a organic heterotetracyclic compound (CHEBI:38163) |
| PX-866 (CHEBI:65345) is a tertiary amino compound (CHEBI:50996) |
| PX-866 (CHEBI:65345) is a δ-lactone (CHEBI:18946) |
| IUPAC Name |
|---|
| (1E,4S,4aR,5R,6aS,9aR)-1-{[di(prop-2-en-1-yl)amino]methylidene}-11-hydroxy-4-(methoxymethyl)-4a,6a-dimethyl-2,7,10-trioxo-1,2,4,4a,5,6,6a,7,8,9,9a,10-dodecahydroindeno[4,5-h]isochromen-5-yl acetate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:12534000 | Reaxys |