EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:52289 - wortmannin
| Formula | C23H24O8 |
| Net Charge | 0 |
| Average Mass | 428.437 |
| Monoisotopic Mass | 428.14712 |
| SMILES | [H][C@@]12CCC(=O)[C@@]1(C)C[C@@H](OC(C)=O)C1=C2C(=O)c2occ3c2[C@]1(C)[C@@H](COC)OC3=O |
| InChI | InChI=1S/C23H24O8/c1-10(24)30-13-7-22(2)12(5-6-14(22)25)16-18(13)23(3)15(9-28-4)31-21(27)11-8-29-20(17(11)23)19(16)26/h8,12-13,15H,5-7,9H2,1-4H3/t12-,13+,15+,22-,23-/m0/s1 |
| InChIKey | QDLHCMPXEPAAMD-QAIWCSMKSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | EC 2.7.1.137 (phosphatidylinositol 3-kinase) inhibitor An inhibitor of phosphatidylinositol 3-kinase, EC 2.7.1.137, a family of related enzymes capable of phosphorylating the 3 position hydroxy group of the inositol ring of a phosphatidylinositol. anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. autophagy inhibitor Any compound that inhibits the process of autophagy (the self-digestion of one or more components of a cell through the action of enzymes originating within the same cell). Penicillium metabolite Any fungal metabolite produced during a metabolic reaction in Penicillium. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. radiosensitizing agent A drug that makes increases the sensitivity of tumour cells to radiation therapy. geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| wortmannin (CHEBI:52289) has role Penicillium metabolite (CHEBI:76964) |
| wortmannin (CHEBI:52289) has role anticoronaviral agent (CHEBI:149553) |
| wortmannin (CHEBI:52289) has role antineoplastic agent (CHEBI:35610) |
| wortmannin (CHEBI:52289) has role autophagy inhibitor (CHEBI:88230) |
| wortmannin (CHEBI:52289) has role EC 2.7.1.137 (phosphatidylinositol 3-kinase) inhibitor (CHEBI:50914) |
| wortmannin (CHEBI:52289) has role geroprotector (CHEBI:176497) |
| wortmannin (CHEBI:52289) has role radiosensitizing agent (CHEBI:132992) |
| wortmannin (CHEBI:52289) is a acetate ester (CHEBI:47622) |
| wortmannin (CHEBI:52289) is a cyclic ketone (CHEBI:3992) |
| wortmannin (CHEBI:52289) is a organic heteropentacyclic compound (CHEBI:38164) |
| wortmannin (CHEBI:52289) is a δ-lactone (CHEBI:18946) |
| Incoming Relation(s) |
| PX-866 (CHEBI:65345) has functional parent wortmannin (CHEBI:52289) |
| IUPAC Name |
|---|
| (1S,6bR,9aS,11R,11bR)-9a,11b-dimethyl-1-[(methyloxy)methyl]-3,6,9-trioxo-1,6,6b,7,8,9,9a,10,11,11b-decahydro-3H-furo[4,3,2-de]indeno[4,5-h]isochromen-11-yl acetate |
| Synonym | Source |
|---|---|
| Wartmannin | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C15181 | KEGG COMPOUND |
| KWT | PDBeChem |
| C00023672 | KNApSAcK |
| LSM-3947 | LINCS |
| DB08059 | DrugBank |
| CPD-11924 | MetaCyc |
| HMDB0259902 | HMDB |
| Wortmannin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:67676 | Reaxys |
| CAS:19545-26-7 | ChemIDplus |
| CAS:19545-26-7 | KEGG COMPOUND |
| Citations |
|---|