EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H19F2N3O3.HCl |
| Net Charge | 0 |
| Average Mass | 387.814 |
| Monoisotopic Mass | 387.11613 |
| SMILES | CCn1cc(C(=O)O)c(=O)c2cc(F)c(N3CCNC(C)C3)c(F)c21.Cl |
| InChI | InChI=1S/C17H19F2N3O3.ClH/c1-3-21-8-11(17(24)25)16(23)10-6-12(18)15(13(19)14(10)21)22-5-4-20-9(2)7-22;/h6,8-9,20H,3-5,7H2,1-2H3,(H,24,25);1H |
| InChIKey | KXEBLAPZMOQCKO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | photosensitizing agent A chemical compound that can be excited by light of a specific wavelength and subsequently transfer energy to a chosen reactant. This is commonly molecular oxygen within a cancer tissue, which is converted to (highly rective) singlet state oxygen. This rapidly reacts with any nearby biomolecules, ultimately killing the cancer cells. antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lomefloxacin hydrochloride (CHEBI:6518) has part lomefloxacin (CHEBI:116278) |
| lomefloxacin hydrochloride (CHEBI:6518) has role antimicrobial agent (CHEBI:33281) |
| lomefloxacin hydrochloride (CHEBI:6518) has role antitubercular agent (CHEBI:33231) |
| lomefloxacin hydrochloride (CHEBI:6518) has role photosensitizing agent (CHEBI:47868) |
| lomefloxacin hydrochloride (CHEBI:6518) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| 1-ethyl-6,8-difluoro-7-(3-methylpiperazin-1-yl)-4-oxo-1,4-dihydroquinoline-3-carboxylic acid hydrochloride |
| Synonyms | Source |
|---|---|
| (±)-1-ethyl-6,8-difluoro-1,4-dihydro-7-(3-methyl-1-piperazinyl)-4-oxo-3-quinolinecarboxylic acid monohydrochloride | ChemIDplus |
| Lomefloxacin (as hydrochloride) | ChEMBL |
| lomefloxacin HCl | ChemIDplus |
| Lomefloxacin monohydrochloride | ChEMBL |
| NSC-758168 | ChEMBL |
| NY-198 | ChEMBL |
| Brand Name | Source |
|---|---|
| Maxaquin | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7506829 | Reaxys |
| CAS:98079-52-8 | ChemIDplus |
| CAS:98079-52-8 | KEGG COMPOUND |
| Citations |
|---|