EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:116278 - lomefloxacin
| Formula | C17H19F2N3O3 |
| Net Charge | 0 |
| Average Mass | 351.353 |
| Monoisotopic Mass | 351.13945 |
| SMILES | CCn1cc(C(=O)O)c(=O)c2cc(F)c(N3CCNC(C)C3)c(F)c21 |
| InChI | InChI=1S/C17H19F2N3O3/c1-3-21-8-11(17(24)25)16(23)10-6-12(18)15(13(19)14(10)21)22-5-4-20-9(2)7-22/h6,8-9,20H,3-5,7H2,1-2H3,(H,24,25) |
| InChIKey | ZEKZLJVOYLTDKK-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. photosensitizing agent A chemical compound that can be excited by light of a specific wavelength and subsequently transfer energy to a chosen reactant. This is commonly molecular oxygen within a cancer tissue, which is converted to (highly rective) singlet state oxygen. This rapidly reacts with any nearby biomolecules, ultimately killing the cancer cells. ophthalmology drug Any compound used for the treatment of eye conditions or eye diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lomefloxacin (CHEBI:116278) has role antibacterial agent (CHEBI:33282) |
| lomefloxacin (CHEBI:116278) has role antimicrobial agent (CHEBI:33281) |
| lomefloxacin (CHEBI:116278) has role antitubercular agent (CHEBI:33231) |
| lomefloxacin (CHEBI:116278) has role ophthalmology drug (CHEBI:66981) |
| lomefloxacin (CHEBI:116278) has role photosensitizing agent (CHEBI:47868) |
| lomefloxacin (CHEBI:116278) is a N-arylpiperazine (CHEBI:46848) |
| lomefloxacin (CHEBI:116278) is a fluoroquinolone antibiotic (CHEBI:87211) |
| lomefloxacin (CHEBI:116278) is a quinolinemonocarboxylic acid (CHEBI:26512) |
| lomefloxacin (CHEBI:116278) is a quinolone (CHEBI:23765) |
| lomefloxacin (CHEBI:116278) is a quinolone antibiotic (CHEBI:86324) |
| Incoming Relation(s) |
| lomefloxacin hydrochloride (CHEBI:6518) has part lomefloxacin (CHEBI:116278) |
| IUPAC Name |
|---|
| 1-ethyl-6,8-difluoro-7-(3-methylpiperazin-1-yl)-4-oxo-1,4-dihydroquinoline-3-carboxylic acid |
| INN | Source |
|---|---|
| lomefloxacin | ChemIDplus |
| Synonyms | Source |
|---|---|
| 1,4-Dihydro-6,8-difluoro-1-ethyl-7-(3-methyl-1-piperazinyl)-4-oxo-3-quinolinecarboxylic acid | ChemIDplus |
| (±)-1-ethyl-6,8-difluoro-1,4-dihydro-7-(3-methyl-1-piperazinyl)-4-oxo-3-quinolinecarboxylic acid | ChemIDplus |
| LFLX | KEGG DRUG |
| Lomefloxacine | DrugBank |
| Lomefloxacino | DrugBank |
| Lomefloxacinum | DrugBank |
| Brand Name | Source |
|---|---|
| Okacyn | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| Beilstein:4210041 | Beilstein |
| CAS:98079-51-7 | KEGG COMPOUND |
| CAS:98079-51-7 | ChemIDplus |
| Citations |
|---|