EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H19F2N3O3 |
| Net Charge | 0 |
| Average Mass | 351.353 |
| Monoisotopic Mass | 351.13945 |
| SMILES | CCn1cc(C(=O)O)c(=O)c2cc(F)c(N3CCNC(C)C3)c(F)c21 |
| InChI | InChI=1S/C17H19F2N3O3/c1-3-21-8-11(17(24)25)16(23)10-6-12(18)15(13(19)14(10)21)22-5-4-20-9(2)7-22/h6,8-9,20H,3-5,7H2,1-2H3,(H,24,25) |
| InChIKey | ZEKZLJVOYLTDKK-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | photosensitizing agent A chemical compound that can be excited by light of a specific wavelength and subsequently transfer energy to a chosen reactant. This is commonly molecular oxygen within a cancer tissue, which is converted to (highly rective) singlet state oxygen. This rapidly reacts with any nearby biomolecules, ultimately killing the cancer cells. antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lomefloxacin (CHEBI:116278) has role antimicrobial agent (CHEBI:33281) |
| lomefloxacin (CHEBI:116278) has role antitubercular agent (CHEBI:33231) |
| lomefloxacin (CHEBI:116278) has role photosensitizing agent (CHEBI:47868) |
| lomefloxacin (CHEBI:116278) is a N-arylpiperazine (CHEBI:46848) |
| lomefloxacin (CHEBI:116278) is a fluoroquinolone antibiotic (CHEBI:87211) |
| lomefloxacin (CHEBI:116278) is a quinolinemonocarboxylic acid (CHEBI:26512) |
| lomefloxacin (CHEBI:116278) is a quinolone (CHEBI:23765) |
| lomefloxacin (CHEBI:116278) is a quinolone antibiotic (CHEBI:86324) |
| Incoming Relation(s) |
| lomefloxacin hydrochloride (CHEBI:6518) has part lomefloxacin (CHEBI:116278) |
| IUPAC Name |
|---|
| 1-ethyl-6,8-difluoro-7-(3-methylpiperazin-1-yl)-4-oxo-1,4-dihydroquinoline-3-carboxylic acid |
| INN | Source |
|---|---|
| lomefloxacin | ChemIDplus |
| Synonyms | Source |
|---|---|
| 1,4-Dihydro-6,8-difluoro-1-ethyl-7-(3-methyl-1-piperazinyl)-4-oxo-3-quinolinecarboxylic acid | ChemIDplus |
| (±)-1-ethyl-6,8-difluoro-1,4-dihydro-7-(3-methyl-1-piperazinyl)-4-oxo-3-quinolinecarboxylic acid | ChemIDplus |
| LFLX | KEGG DRUG |
| Lomefloxacine | DrugBank |
| Lomefloxacino | DrugBank |
| Lomefloxacinum | DrugBank |
| Registry Numbers | Sources |
|---|---|
| Beilstein:4210041 | Beilstein |
| CAS:98079-51-7 | ChemIDplus |
| CAS:98079-51-7 | KEGG COMPOUND |
| Citations |
|---|