EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H4O5 |
| Net Charge | 0 |
| Average Mass | 168.104 |
| Monoisotopic Mass | 168.00587 |
| SMILES | O=C1C=C/C(=C/C(=O)C(=O)O)O1 |
| InChI | InChI=1S/C7H4O5/c8-5(7(10)11)3-4-1-2-6(9)12-4/h1-3H,(H,10,11)/b4-3- |
| InChIKey | DDHFXYAKWRQJJH-ARJAWSKDSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-oxo-3-(5-oxofuran-2-ylidene)propanoic acid (CHEBI:65114) has functional parent pyruvic acid (CHEBI:32816) |
| 2-oxo-3-(5-oxofuran-2-ylidene)propanoic acid (CHEBI:65114) is a 2-oxo monocarboxylic acid (CHEBI:35910) |
| 2-oxo-3-(5-oxofuran-2-ylidene)propanoic acid (CHEBI:65114) is a butenolide (CHEBI:50523) |
| 2-oxo-3-(5-oxofuran-2-ylidene)propanoic acid (CHEBI:65114) is conjugate acid of 2-oxo-3-(5-oxofuran-2-ylidene)propanoate (CHEBI:65081) |
| Incoming Relation(s) |
| 2-oxo-3-(5-oxofuran-2-ylidene)propanoate (CHEBI:65081) is conjugate base of 2-oxo-3-(5-oxofuran-2-ylidene)propanoic acid (CHEBI:65114) |
| IUPAC Name |
|---|
| (3Z)-2-oxo-3-(5-oxofuran-2(5H)-ylidene)propanoic acid |