EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H3O5 |
| Net Charge | -1 |
| Average Mass | 167.096 |
| Monoisotopic Mass | 166.99860 |
| SMILES | O=C1C=C/C(=C/C(=O)C(=O)[O-])O1 |
| InChI | InChI=1S/C7H4O5/c8-5(7(10)11)3-4-1-2-6(9)12-4/h1-3H,(H,10,11)/p-1/b4-3- |
| InChIKey | DDHFXYAKWRQJJH-ARJAWSKDSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-oxo-3-(5-oxofuran-2-ylidene)propanoate (CHEBI:65081) is a 2-oxo monocarboxylic acid anion (CHEBI:35179) |
| 2-oxo-3-(5-oxofuran-2-ylidene)propanoate (CHEBI:65081) is conjugate base of 2-oxo-3-(5-oxofuran-2-ylidene)propanoic acid (CHEBI:65114) |
| Incoming Relation(s) |
| 2-oxo-3-(5-oxofuran-2-ylidene)propanoic acid (CHEBI:65114) is conjugate acid of 2-oxo-3-(5-oxofuran-2-ylidene)propanoate (CHEBI:65081) |
| IUPAC Name |
|---|
| (3Z)-2-oxo-3-(5-oxofuran-2(5H)-ylidene)propanoate |
| Synonym | Source |
|---|---|
| 2-oxo-3-(5-oxofuran-2-ylidene)propanoate(1−) | ChEBI |
| UniProt Name | Source |
|---|---|
| 2-oxo-3-(5-oxofuran-2-ylidene)propanoate | UniProt |
| Citations |
|---|