EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H13NO4 |
| Net Charge | 0 |
| Average Mass | 163.173 |
| Monoisotopic Mass | 163.08446 |
| SMILES | N[C@H]1C[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C6H13NO4/c7-2-1-3(8)5(10)6(11)4(2)9/h2-6,8-11H,1,7H2/t2-,3+,4+,5-,6-/m0/s1 |
| InChIKey | QXQNRSUOYNMXDL-KGJVWPDLSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-deoxy-scyllo-inosamine (CHEBI:65046) has functional parent scyllo-inositol (CHEBI:10642) |
| 2-deoxy-scyllo-inosamine (CHEBI:65046) is a amino cyclitol (CHEBI:61689) |
| 2-deoxy-scyllo-inosamine (CHEBI:65046) is conjugate base of 2-deoxy-scyllo-inosamine(1+) (CHEBI:65003) |
| Incoming Relation(s) |
| 2-deoxy-scyllo-inosamine(1+) (CHEBI:65003) is conjugate acid of 2-deoxy-scyllo-inosamine (CHEBI:65046) |
| IUPAC Name |
|---|
| (1R,2S,3S,4R,5S)-5-aminocyclohexane-1,2,3,4-tetrol |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5728627 | Reaxys |
| CAS:72075-06-0 | KEGG COMPOUND |
| CAS:72075-06-0 | ChemIDplus |