EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H14NO4 |
| Net Charge | +1 |
| Average Mass | 164.181 |
| Monoisotopic Mass | 164.09173 |
| SMILES | [NH3+][C@H]1C[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C6H13NO4/c7-2-1-3(8)5(10)6(11)4(2)9/h2-6,8-11H,1,7H2/p+1/t2-,3+,4+,5-,6-/m0/s1 |
| InChIKey | QXQNRSUOYNMXDL-KGJVWPDLSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-deoxy-scyllo-inosamine(1+) (CHEBI:65003) is a ammonium ion derivative (CHEBI:35274) |
| 2-deoxy-scyllo-inosamine(1+) (CHEBI:65003) is a organic cation (CHEBI:25697) |
| 2-deoxy-scyllo-inosamine(1+) (CHEBI:65003) is conjugate acid of 2-deoxy-scyllo-inosamine (CHEBI:65046) |
| Incoming Relation(s) |
| 2-deoxy-scyllo-inosamine (CHEBI:65046) is conjugate base of 2-deoxy-scyllo-inosamine(1+) (CHEBI:65003) |
| IUPAC Name |
|---|
| (1S,2R,3S,4S,5R)-2,3,4,5-tetrahydroxycyclohexanaminium |
| Synonyms | Source |
|---|---|
| (1R,2S,3S,4R,5S)-5-aminocyclohexane-1,2,3,4-tetrol | SUBMITTER |
| 2-deoxy-scyllo-inosaminium(1+) | ChEBI |
| UniProt Name | Source |
|---|---|
| 2-deoxy-scyllo-inosamine | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-14122 | MetaCyc |
| Citations |
|---|