EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32 |
| Net Charge | 0 |
| Average Mass | 272.476 |
| Monoisotopic Mass | 272.25040 |
| SMILES | [H][C@@]12CCC3=C(CC=C(C(C)C)C3)[C@@]1(C)CCCC2(C)C |
| InChI | InChI=1S/C20H32/c1-14(2)15-7-9-17-16(13-15)8-10-18-19(3,4)11-6-12-20(17,18)5/h7,14,18H,6,8-13H2,1-5H3/t18-,20+/m0/s1 |
| InChIKey | BGVUIJDZTQIJIO-AZUAARDMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Tripterygium wilfordii (ncbitaxon:458696) | - | PubMed (26449416) | |
| Salvia rosmarinus (ncbitaxon:39367) | - | DOI (10.1038/ncomms12942) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| miltiradiene (CHEBI:65037) has role plant metabolite (CHEBI:76924) |
| miltiradiene (CHEBI:65037) is a abietadiene (CHEBI:50072) |
| miltiradiene (CHEBI:65037) is a carbotricyclic compound (CHEBI:38032) |
| Incoming Relation(s) |
| 11-oxomiltiradiene (CHEBI:167496) has functional parent miltiradiene (CHEBI:65037) |
| miltiradien-20-al (CHEBI:167488) has functional parent miltiradiene (CHEBI:65037) |
| IUPAC Name |
|---|
| abieta-8,12-diene |
| UniProt Name | Source |
|---|---|
| miltiradiene | UniProt |
| Citations |
|---|