EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H30O |
| Net Charge | 0 |
| Average Mass | 286.459 |
| Monoisotopic Mass | 286.22967 |
| SMILES | [H][C@@]12CCC3=C(CC=C(C(C)C)C3)[C@@]1(C=O)CCCC2(C)C |
| InChI | InChI=1S/C20H30O/c1-14(2)15-6-8-17-16(12-15)7-9-18-19(3,4)10-5-11-20(17,18)13-21/h6,13-14,18H,5,7-12H2,1-4H3/t18-,20-/m0/s1 |
| InChIKey | DXZVYKQSBOZWKK-ICSRJNTNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Nicotiana benthamiana (ncbitaxon:4100) | leaf (BTO:0000713) | PubMed (27703160) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| miltiradien-20-al (CHEBI:167488) has functional parent miltiradiene (CHEBI:65037) |
| miltiradien-20-al (CHEBI:167488) has role plant metabolite (CHEBI:76924) |
| miltiradien-20-al (CHEBI:167488) is a abietane diterpenoid (CHEBI:36762) |
| miltiradien-20-al (CHEBI:167488) is a carbotricyclic compound (CHEBI:38032) |
| miltiradien-20-al (CHEBI:167488) is a tricyclic diterpenoid (CHEBI:79084) |
| IUPAC Name |
|---|
| abieta-8,12-dien-20-al |
| UniProt Name | Source |
|---|---|
| miltiradien-20-al | UniProt |
| Citations |
|---|