EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:65011 - nicotine blue
| Formula | C10H6N2O6 |
| Net Charge | 0 |
| Average Mass | 250.166 |
| Monoisotopic Mass | 250.02259 |
| SMILES | O=C1N=C(O)/C(=C2\C=C(O)C(=O)N=C2O)C=C1O |
| InChI | InChI=1S/C10H6N2O6/c13-5-1-3(7(15)11-9(5)17)4-2-6(14)10(18)12-8(4)16/h1-2,13-14H,(H,11,15,17)(H,12,16,18)/b4-3+ |
| InChIKey | JUTQRXXDIORLET-ONEGZZNKSA-N |
| Roles Classification |
|---|
| Biological Role: | biological pigment An endogenous molecular entity that results in a colour of an organism as the consequence of the selective absorption of light. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nicotine blue (CHEBI:65011) has functional parent 2,3,6-trihydroxypyridine (CHEBI:16683) |
| nicotine blue (CHEBI:65011) has role biological pigment (CHEBI:26130) |
| nicotine blue (CHEBI:65011) is a extended quinone (CHEBI:65013) |
| nicotine blue (CHEBI:65011) is conjugate acid of nicotine blue(2−) (CHEBI:64998) |
| Incoming Relation(s) |
| nicotine blue(2−) (CHEBI:64998) is conjugate base of nicotine blue (CHEBI:65011) |
| IUPAC Names |
|---|
| (3E)-5-hydroxy-3-(5-hydroxy-2,6-dioxo-1,6-dihydropyridin-3(2H)-ylidene)pyridine-2,6(1H,3H)-dione |
| (5E)-5-(2,5-dihydroxy-6-oxopyridin-3(6H)-ylidene)-3,6-dihydroxypyridin-2(5H)-one |
| Synonym | Source |
|---|---|
| Diazodiphenoquinone | ChemIDplus |
| Citations |
|---|