EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H4N2O6 |
| Net Charge | -2 |
| Average Mass | 248.150 |
| Monoisotopic Mass | 248.00803 |
| SMILES | O=C1N=C([O-])/C(=C2\C=C(O)C(=O)N=C2[O-])C=C1O |
| InChI | InChI=1S/C10H6N2O6/c13-5-1-3(7(15)11-9(5)17)4-2-6(14)10(18)12-8(4)16/h1-2,13-14H,(H,11,15,17)(H,12,16,18)/p-2/b4-3+ |
| InChIKey | JUTQRXXDIORLET-ONEGZZNKSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nicotine blue(2−) (CHEBI:64998) is a organic anion (CHEBI:25696) |
| nicotine blue(2−) (CHEBI:64998) is conjugate base of nicotine blue (CHEBI:65011) |
| Incoming Relation(s) |
| nicotine blue (CHEBI:65011) is conjugate acid of nicotine blue(2−) (CHEBI:64998) |
| IUPAC Name |
|---|
| (5E)-6-hydroxy-5-(2-hydroxy-5-oxido-6-oxopyridin-3(6H)-ylidene)-2-oxo-2,5-dihydropyridin-3-olate |
| Synonym | Source |
|---|---|
| nicotine blue | SUBMITTER |
| UniProt Name | Source |
|---|---|
| (E)-2,2',5,5'-tetrahydroxy-6H,6'H-(3,3'-bipyridinylidene)-6,6'-dione | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-14081 | MetaCyc |
| Citations |
|---|