EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H26N4O7S |
| Net Charge | 0 |
| Average Mass | 466.516 |
| Monoisotopic Mass | 466.15222 |
| SMILES | COc1cccc2ncc(CSC[C@H](NC(=O)CC[C@H](N)C(=O)O)C(=O)NCC(=O)O)c12 |
| InChI | InChI=1S/C20H26N4O7S/c1-31-15-4-2-3-13-18(15)11(7-22-13)9-32-10-14(19(28)23-8-17(26)27)24-16(25)6-5-12(21)20(29)30/h2-4,7,12,14,22H,5-6,8-10,21H2,1H3,(H,23,28)(H,24,25)(H,26,27)(H,29,30)/t12-,14-/m0/s1 |
| InChIKey | VQCJUVLBCCMWJY-JSGCOSHPSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| γGluCys(4MeOI3M)Gly (CHEBI:65007) has functional parent indole-3-methanol (CHEBI:24814) |
| γGluCys(4MeOI3M)Gly (CHEBI:65007) has role metabolite (CHEBI:25212) |
| γGluCys(4MeOI3M)Gly (CHEBI:65007) is a S-conjugate (CHEBI:64987) |
| γGluCys(4MeOI3M)Gly (CHEBI:65007) is a glutathione derivative (CHEBI:24337) |
| γGluCys(4MeOI3M)Gly (CHEBI:65007) is a indoles (CHEBI:24828) |
| γGluCys(4MeOI3M)Gly (CHEBI:65007) is a tripeptide (CHEBI:47923) |
| IUPAC Name |
|---|
| L-γ-glutamyl-S-[(4-methoxy-1H-indol-3-yl)methyl]-L-cysteinylglycine |
| Synonyms | Source |
|---|---|
| S-(4-methoxyindol-3-ylmethyl)-glutathione | ChEBI |
| L-γGlu-L-Cys-(4MeOI3M)-Gly | ChEBI |