EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H9NO |
| Net Charge | 0 |
| Average Mass | 147.177 |
| Monoisotopic Mass | 147.06841 |
| SMILES | OCc1cnc2ccccc12 |
| InChI | InChI=1S/C9H9NO/c11-6-7-5-10-9-4-2-1-3-8(7)9/h1-5,10-11H,6H2 |
| InChIKey | IVYPNXXAYMYVSP-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| indole-3-methanol (CHEBI:24814) has role antineoplastic agent (CHEBI:35610) |
| indole-3-methanol (CHEBI:24814) has role plant metabolite (CHEBI:76924) |
| indole-3-methanol (CHEBI:24814) is a indolyl alcohol (CHEBI:38467) |
| Incoming Relation(s) |
| γGluCys(4MeOI3M)Gly (CHEBI:65007) has functional parent indole-3-methanol (CHEBI:24814) |
| IUPAC Name |
|---|
| 1H-indol-3-ylmethanol |
| Synonyms | Source |
|---|---|
| 3-hydroxymethylindole | ChemIDplus |
| 3-indolylcarbinol | ChemIDplus |
| indole-3-carbinol | ChemIDplus |
| indole-3-methanol | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| HMDB0005785 | HMDB |
| Indole-3-carbinol | Wikipedia |
| LSM-2011 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:121323 | Reaxys |
| Gmelin:1603301 | Gmelin |
| CAS:700-06-1 | ChemIDplus |
| Citations |
|---|