EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H26O8PR |
| Net Charge | 0 |
| Average Mass (excl. R groups) | 353.326 |
| Monoisotopic Mass (excl. R groups) | 353.13653 |
| SMILES | *C(=O)OC[C@]([H])(COP(=O)(O)O)OC(=O)CCCCCCCCC |
| Roles Classification |
|---|
| Biological Role: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-acyl-2-decanoyl-sn-glycero-3-phosphate (CHEBI:64878) is a 1,2-diacyl-sn-glycerol 3-phosphate (CHEBI:29089) |
| 1-acyl-2-decanoyl-sn-glycero-3-phosphate (CHEBI:64878) is a decanoate ester (CHEBI:87658) |
| 1-acyl-2-decanoyl-sn-glycero-3-phosphate (CHEBI:64878) is conjugate acid of 1-acyl-2-decanoyl-sn-glycero-3-phosphate(2−) (CHEBI:64866) |
| Incoming Relation(s) |
| 1-acyl-2-decanoyl-sn-glycero-3-phosphate(2−) (CHEBI:64866) is conjugate base of 1-acyl-2-decanoyl-sn-glycero-3-phosphate (CHEBI:64878) |