EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H24O8PR |
| Net Charge | -2 |
| Average Mass (excl. R groups) | 351.310 |
| Monoisotopic Mass (excl. R groups) | 351.12088 |
| SMILES | *C(=O)OC[C@]([H])(COP(=O)([O-])[O-])OC(=O)CCCCCCCCC |
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-acyl-2-decanoyl-sn-glycero-3-phosphate(2−) (CHEBI:64866) is a 1,2-diacyl-sn-glycerol 3-phosphate(2−) (CHEBI:58608) |
| 1-acyl-2-decanoyl-sn-glycero-3-phosphate(2−) (CHEBI:64866) is a organic molecular entity (CHEBI:50860) |
| 1-acyl-2-decanoyl-sn-glycero-3-phosphate(2−) (CHEBI:64866) is conjugate base of 1-acyl-2-decanoyl-sn-glycero-3-phosphate (CHEBI:64878) |
| Incoming Relation(s) |
| 1-acyl-2-decanoyl-sn-glycero-3-phosphate (CHEBI:64878) is conjugate acid of 1-acyl-2-decanoyl-sn-glycero-3-phosphate(2−) (CHEBI:64866) |
| Synonym | Source |
|---|---|
| 1-acyl-2-decanoyl-sn-glycero-3-phosphate | ChEBI |
| UniProt Name | Source |
|---|---|
| 1-acyl-2-decanoyl-sn-glycero-3-phosphate | UniProt |