EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H18N2O3 |
| Net Charge | 0 |
| Average Mass | 202.254 |
| Monoisotopic Mass | 202.13174 |
| SMILES | COC(=O)[C@H](CCCCN)NC(C)=O |
| InChI | InChI=1S/C9H18N2O3/c1-7(12)11-8(9(13)14-2)5-3-4-6-10/h8H,3-6,10H2,1-2H3,(H,11,12)/t8-/m0/s1 |
| InChIKey | HHOLXTXLQMKUGJ-QMMMGPOBSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Nα-acetyl-L-lysine methyl ester (CHEBI:64859) is a L-lysine derivative (CHEBI:25095) |
| Nα-acetyl-L-lysine methyl ester (CHEBI:64859) is a acetamides (CHEBI:22160) |
| Nα-acetyl-L-lysine methyl ester (CHEBI:64859) is a methyl ester (CHEBI:25248) |
| Nα-acetyl-L-lysine methyl ester (CHEBI:64859) is a primary amino compound (CHEBI:50994) |
| Nα-acetyl-L-lysine methyl ester (CHEBI:64859) is a α-amino acid ester (CHEBI:46874) |
| Nα-acetyl-L-lysine methyl ester (CHEBI:64859) is conjugate base of Nα-acetyl-L-lysine methyl ester(1+) (CHEBI:64854) |
| Incoming Relation(s) |
| Nα-acetyl-L-lysine methyl ester(1+) (CHEBI:64854) is conjugate acid of Nα-acetyl-L-lysine methyl ester (CHEBI:64859) |
| IUPAC Name |
|---|
| methyl N2-acetyl-L-lysinate |
| Synonyms | Source |
|---|---|
| alpha-Acetyl-L-lysine methyl ester | ChemIDplus |
| alpha-Acetyllysine methyl ester | ChemIDplus |
| methyl N-acetyl-6-amino-L-norleucinate | ChEBI |
| methyl N-acetyl-L-lysinate | ChEBI |
| methyl N2-acetyllysinate | ChEBI |
| Citations |
|---|