EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H19N2O3 |
| Net Charge | +1 |
| Average Mass | 203.262 |
| Monoisotopic Mass | 203.13902 |
| SMILES | COC(=O)[C@H](CCCC[NH3+])NC(C)=O |
| InChI | InChI=1S/C9H18N2O3/c1-7(12)11-8(9(13)14-2)5-3-4-6-10/h8H,3-6,10H2,1-2H3,(H,11,12)/p+1/t8-/m0/s1 |
| InChIKey | HHOLXTXLQMKUGJ-QMMMGPOBSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Nα-acetyl-L-lysine methyl ester(1+) (CHEBI:64854) has functional parent L-lysinium(1+) (CHEBI:32551) |
| Nα-acetyl-L-lysine methyl ester(1+) (CHEBI:64854) is a ammonium ion derivative (CHEBI:35274) |
| Nα-acetyl-L-lysine methyl ester(1+) (CHEBI:64854) is a organic cation (CHEBI:25697) |
| Nα-acetyl-L-lysine methyl ester(1+) (CHEBI:64854) is conjugate acid of Nα-acetyl-L-lysine methyl ester (CHEBI:64859) |
| Incoming Relation(s) |
| Nα-acetyl-L-lysine methyl ester (CHEBI:64859) is conjugate base of Nα-acetyl-L-lysine methyl ester(1+) (CHEBI:64854) |
| IUPAC Name |
|---|
| methyl N-acetyl-6-azaniumyl-L-norleucinate |
| Synonyms | Source |
|---|---|
| methyl N-acetyl-6-ammonio-L-norleucinate | IUPAC |
| methyl N-acetyl-L-lysinate(1+) | ChEBI |
| N-α-acetyl-lysine methyl ester | MetaCyc |
| UniProt Name | Source |
|---|---|
| Nα-acetyl-L-lysine methyl ester | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD0-1442 | MetaCyc |