EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H8N2O3S |
| Net Charge | 0 |
| Average Mass | 164.186 |
| Monoisotopic Mass | 164.02556 |
| SMILES | NC(=O)N[C@@H](CS)C(=O)O |
| InChI | InChI=1S/C4H8N2O3S/c5-4(9)6-2(1-10)3(7)8/h2,10H,1H2,(H,7,8)(H3,5,6,9)/t2-/m0/s1 |
| InChIKey | APFSAMXTZRYBKF-REOHCLBHSA-N |
| Roles Classification |
|---|
| Biological Role: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Application: | cosmetic The role played by a substance in enhancing the appearance or odour of the human body; a name given to the substance itself or to a component of it. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-carbamoyl-L-cysteine (CHEBI:64855) has role antifungal agent (CHEBI:35718) |
| N-carbamoyl-L-cysteine (CHEBI:64855) has role cosmetic (CHEBI:64857) |
| N-carbamoyl-L-cysteine (CHEBI:64855) is a L-cysteine derivative (CHEBI:83824) |
| N-carbamoyl-L-cysteine (CHEBI:64855) is conjugate acid of N-carbamoyl-L-cysteinate(1−) (CHEBI:64772) |
| Incoming Relation(s) |
| N-carbamoyl-L-cysteinate(1−) (CHEBI:64772) is conjugate base of N-carbamoyl-L-cysteine (CHEBI:64855) |
| IUPAC Names |
|---|
| (2R)-2-(carbamoylamino)-3-sulfanylpropanoic acid |
| N-carbamoyl-L-cysteine |
| Synonyms | Source |
|---|---|
| L-Cysteine-N-carbamide | ChemIDplus |
| N-(Aminocarbonyl)cysteine | ChEBI |
| L-NCC | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:13349895 | Reaxys |
| CAS:24583-23-1 | ChemIDplus |
| Citations |
|---|