EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H7N2O3S |
| Net Charge | -1 |
| Average Mass | 163.178 |
| Monoisotopic Mass | 163.01829 |
| SMILES | NC(=O)N[C@@H](CS)C(=O)[O-] |
| InChI | InChI=1S/C4H8N2O3S/c5-4(9)6-2(1-10)3(7)8/h2,10H,1H2,(H,7,8)(H3,5,6,9)/p-1/t2-/m0/s1 |
| InChIKey | APFSAMXTZRYBKF-REOHCLBHSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-carbamoyl-L-cysteinate(1−) (CHEBI:64772) is a N-acyl-L-α-amino acid anion (CHEBI:59874) |
| N-carbamoyl-L-cysteinate(1−) (CHEBI:64772) is a N-carbamoyl-L-α-amino acid anion (CHEBI:58865) |
| N-carbamoyl-L-cysteinate(1−) (CHEBI:64772) is conjugate base of N-carbamoyl-L-cysteine (CHEBI:64855) |
| Incoming Relation(s) |
| N-carbamoyl-L-cysteine (CHEBI:64855) is conjugate acid of N-carbamoyl-L-cysteinate(1−) (CHEBI:64772) |
| IUPAC Name |
|---|
| (2R)-2-(carbamoylamino)-3-sulfanylpropanoate |
| UniProt Name | Source |
|---|---|
| N-carbamoyl-L-cysteine | UniProt |
| Citations |
|---|