EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H21N6O9P |
| Net Charge | 0 |
| Average Mass | 448.329 |
| Monoisotopic Mass | 448.11076 |
| SMILES | C[C@@H](O)[C@H](N)C(=O)OP(=O)(O)OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C14H21N6O9P/c1-5(21)7(15)14(24)29-30(25,26)27-2-6-9(22)10(23)13(28-6)20-4-19-8-11(16)17-3-18-12(8)20/h3-7,9-10,13,21-23H,2,15H2,1H3,(H,25,26)(H2,16,17,18)/t5-,6-,7+,9-,10-,13-/m1/s1 |
| InChIKey | YYBNSQASHCKPHX-DWVDDHQFSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-threonyl-AMP (CHEBI:64851) has functional parent adenosine 5'-monophosphate (CHEBI:16027) |
| L-threonyl-AMP (CHEBI:64851) is a L-threonine derivative (CHEBI:84189) |
| L-threonyl-AMP (CHEBI:64851) is a purine ribonucleoside 5'-monophosphate (CHEBI:37021) |
| L-threonyl-AMP (CHEBI:64851) is conjugate acid of L-threonyl-AMP(1−) (CHEBI:64847) |
| Incoming Relation(s) |
| L-threonyl-AMP(1−) (CHEBI:64847) is conjugate base of L-threonyl-AMP (CHEBI:64851) |
| IUPAC Name |
|---|
| 5'-O-[(L-threonyloxy)(hydroxy)phosphoryl]adenosine |
| Synonyms | Source |
|---|---|
| 5'-adenylic acid L-threonine anhydride | ChEBI |
| L-threonyl adenylate | ChEBI |
| threonyl adenylate | ChEBI |
| 5'-O-[{[(2S,3R)-2-amino-3-hydroxybutanoyl]oxy}(hydroxy)phosphoryl]adenosine | IUPAC |
| Manual Xrefs | Databases |
|---|---|
| CPD-9994 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:68657 | Reaxys |
| Citations |
|---|