EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H11O2 |
| Net Charge | -1 |
| Average Mass | 163.196 |
| Monoisotopic Mass | 163.07645 |
| SMILES | Cc1cc(C)c(C(=O)[O-])c(C)c1 |
| InChI | InChI=1S/C10H12O2/c1-6-4-7(2)9(10(11)12)8(3)5-6/h4-5H,1-3H3,(H,11,12)/p-1 |
| InChIKey | FFFIRKXTFQCCKJ-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,4,6-trimethylbenzoate (CHEBI:64832) has functional parent benzoate (CHEBI:16150) |
| 2,4,6-trimethylbenzoate (CHEBI:64832) is a trimethylbenzoate (CHEBI:64831) |
| 2,4,6-trimethylbenzoate (CHEBI:64832) is conjugate base of 2,4,6-trimethylbenzoic acid (CHEBI:64830) |
| Incoming Relation(s) |
| 2,4,6-trimethylbenzoic acid (CHEBI:64830) is conjugate acid of 2,4,6-trimethylbenzoate (CHEBI:64832) |
| IUPAC Name |
|---|
| 2,4,6-trimethylbenzoate |
| Synonym | Source |
|---|---|
| 2,4,6-trimethylbenzoate anion | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3905883 | Reaxys |