EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H30NO11 |
| Net Charge | +1 |
| Average Mass | 544.533 |
| Monoisotopic Mass | 544.18134 |
| SMILES | COc1cccc2c1C(=O)c1c(O)c3c(c(O)c1C2=O)C[C@@](O)(C(=O)CO)C[C@@H]3O[C@H]1C[C@H]([NH3+])[C@H](O)[C@H](C)O1 |
| InChI | InChI=1S/C27H29NO11/c1-10-22(31)13(28)6-17(38-10)39-15-8-27(36,16(30)9-29)7-12-19(15)26(35)21-20(24(12)33)23(32)11-4-3-5-14(37-2)18(11)25(21)34/h3-5,10,13,15,17,22,29,31,33,35-36H,6-9,28H2,1-2H3/p+1/t10-,13-,15-,17-,22+,27-/m0/s1 |
| InChIKey | AOJJSUZBOXZQNB-TZSSRYMLSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| doxorubicin(1+) (CHEBI:64816) is a anthracycline cation (CHEBI:64678) |
| doxorubicin(1+) (CHEBI:64816) is conjugate acid of doxorubicin (CHEBI:28748) |
| Incoming Relation(s) |
| doxorubicin (CHEBI:28748) is conjugate base of doxorubicin(1+) (CHEBI:64816) |
| IUPAC Name |
|---|
| (1S,3S)-3,5,12-trihydroxy-3-(hydroxyacetyl)-10-methoxy-6,11-dioxo-1,2,3,4,6,11-hexahydrotetracen-1-yl 3-azaniumyl-2,3,6-trideoxy-α-L-lyxo-hexopyranoside |
| Synonym | Source |
|---|---|
| doxorubicin cation | ChEBI |
| UniProt Name | Source |
|---|---|
| doxorubicin | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5898339 | Reaxys |