EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H34N2O6S |
| Net Charge | 0 |
| Average Mass | 406.545 |
| Monoisotopic Mass | 406.21376 |
| SMILES | [H][C@@]1(C(=O)N[C@@H]([C@H]2O[C@H](SC)[C@H](O)[C@@H](O)[C@H]2O)[C@@H](C)O)C[C@@H](CCC)CN1C |
| InChI | InChI=1S/C18H34N2O6S/c1-5-6-10-7-11(20(3)8-10)17(25)19-12(9(2)21)16-14(23)13(22)15(24)18(26-16)27-4/h9-16,18,21-24H,5-8H2,1-4H3,(H,19,25)/t9-,10-,11+,12-,13+,14-,15-,16-,18-/m1/s1 |
| InChIKey | OJMMVQQUTAEWLP-KIDUDLJLSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lincomycin (CHEBI:6472) has role antimicrobial agent (CHEBI:33281) |
| lincomycin (CHEBI:6472) has role bacterial metabolite (CHEBI:76969) |
| lincomycin (CHEBI:6472) is a S-glycosyl compound (CHEBI:35275) |
| lincomycin (CHEBI:6472) is a L-proline derivative (CHEBI:84186) |
| lincomycin (CHEBI:6472) is a carbohydrate-containing antibiotic (CHEBI:23007) |
| lincomycin (CHEBI:6472) is a monocarboxylic acid amide (CHEBI:29347) |
| lincomycin (CHEBI:6472) is a pyrrolidinecarboxamide (CHEBI:46770) |
| Incoming Relation(s) |
| clindamycin (CHEBI:3745) has functional parent lincomycin (CHEBI:6472) |
| IUPAC Name |
|---|
| methyl 6,8-dideoxy-6-({[(2S,4R)-1-methyl-4-propylpyrrolidin-2-yl]carbonyl}amino)-1-thio-D-erythro-α-D-galacto-octopyranoside |
| INNs | Source |
|---|---|
| lincomycine | ChemIDplus |
| lincomycinum | ChemIDplus |
| lincomicina | ChemIDplus |
| lincomycin | WHO MedNet |
| Synonyms | Source |
|---|---|
| Lincomycin | KEGG COMPOUND |
| Methyl 6,8-dideoxy-6-trans-(1-methyl-4-propyl-L-2-pyrrolidinecarboxamido)-1-thio-D-erythro-α-D-galacto-octopyranoside | NIST Chemistry WebBook |
| Cillimycin | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C06812 | KEGG COMPOUND |
| D00223 | KEGG DRUG |
| DB01627 | DrugBank |
| Lincomycin | Wikipedia |
| HMDB0015564 | HMDB |
| C14002 | KEGG COMPOUND |
| D02346 | KEGG DRUG |
| LSM-5602 | LINCS |
| 1582 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Reaxys:707677 | Reaxys |
| CAS:154-21-2 | KEGG COMPOUND |
| CAS:154-21-2 | ChemIDplus |
| Citations |
|---|