EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H33ClN2O5S |
| Net Charge | 0 |
| Average Mass | 424.991 |
| Monoisotopic Mass | 424.17987 |
| SMILES | [H][C@]1([C@H](NC(=O)[C@@H]2C[C@@H](CCC)CN2C)[C@H](C)Cl)O[C@H](SC)[C@H](O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C18H33ClN2O5S/c1-5-6-10-7-11(21(3)8-10)17(25)20-12(9(2)19)16-14(23)13(22)15(24)18(26-16)27-4/h9-16,18,22-24H,5-8H2,1-4H3,(H,20,25)/t9-,10+,11-,12+,13-,14+,15+,16+,18+/m0/s1 |
| InChIKey | KDLRVYVGXIQJDK-AWPVFWJPSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Roles: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| clindamycin (CHEBI:3745) has functional parent lincomycin (CHEBI:6472) |
| clindamycin (CHEBI:3745) has role environmental contaminant (CHEBI:78298) |
| clindamycin (CHEBI:3745) has role xenobiotic (CHEBI:35703) |
| clindamycin (CHEBI:3745) is a S-glycosyl compound (CHEBI:35275) |
| clindamycin (CHEBI:3745) is a carbohydrate-containing antibiotic (CHEBI:23007) |
| clindamycin (CHEBI:3745) is a organochlorine compound (CHEBI:36683) |
| clindamycin (CHEBI:3745) is a pyrrolidinecarboxamide (CHEBI:46770) |
| clindamycin (CHEBI:3745) is a semisynthetic derivative (CHEBI:72588) |
| Incoming Relation(s) |
| clindamycin phosphate (CHEBI:3746) has functional parent clindamycin (CHEBI:3745) |
| IUPAC Name |
|---|
| methyl 7-chloro-6,7,8-trideoxy-6-{[(4R)-1-methyl-4-propyl-L-prolyl]amino}-1-thio-L-threo-α-D-galacto-octopyranoside |
| Synonyms | Source |
|---|---|
| 7-CDL | ChemIDplus |
| 7-deoxy-7(S)-chlorolincomycin | CAS |
| 7(S)-chloro-7-deoxylincomycin | ChemIDplus |
| Cleocin (TN) | KEGG DRUG |
| Clindamycin | KEGG COMPOUND |
| Methyl 7-chloro-6,7,8-trideoxy-6-(1-methyl-trans-4-propyl-L-2-pyrrolidinecarboxamido)-1-thio-L-threo-alpha-D-galacto-octopyranoside | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 678 | DrugCentral |
| C06914 | KEGG COMPOUND |
| Clindamycin | Wikipedia |
| CLY | PDBeChem |
| D00277 | KEGG DRUG |
| DB01190 | DrugBank |
| HMDB0015321 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5624049 | Reaxys |
| CAS:18323-44-9 | KEGG COMPOUND |
| CAS:18323-44-9 | CAS |
| Citations |
|---|