EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H14N2O2 |
| Net Charge | 0 |
| Average Mass | 146.190 |
| Monoisotopic Mass | 146.10553 |
| SMILES | C[C@H](CCN)[C@@H](N)C(=O)O |
| InChI | InChI=1S/C6H14N2O2/c1-4(2-3-7)5(8)6(9)10/h4-5H,2-3,7-8H2,1H3,(H,9,10)/t4-,5-/m1/s1 |
| InChIKey | HYUPFEBCCJWDJX-RFZPGFLSSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (3R)-3-methyl-D-ornithine (CHEBI:64693) is a D-isoleucine derivative (CHEBI:84113) |
| (3R)-3-methyl-D-ornithine (CHEBI:64693) is a D-α-amino acid (CHEBI:16733) |
| (3R)-3-methyl-D-ornithine (CHEBI:64693) is conjugate base of (3R)-3-methyl-D-ornithine(1+) (CHEBI:64642) |
| Incoming Relation(s) |
| (3R)-3-methyl-D-ornithine(1+) (CHEBI:64642) is conjugate acid of (3R)-3-methyl-D-ornithine (CHEBI:64693) |
| IUPAC Name |
|---|
| 5-amino-D-isoleucine |
| Citations |
|---|