EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H15N2O2 |
| Net Charge | +1 |
| Average Mass | 147.198 |
| Monoisotopic Mass | 147.11280 |
| SMILES | C[C@H](CC[NH3+])[C@@H]([NH3+])C(=O)[O-] |
| InChI | InChI=1S/C6H14N2O2/c1-4(2-3-7)5(8)6(9)10/h4-5H,2-3,7-8H2,1H3,(H,9,10)/p+1/t4-,5-/m1/s1 |
| InChIKey | HYUPFEBCCJWDJX-RFZPGFLSSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (3R)-3-methyl-D-ornithine(1+) (CHEBI:64642) is a amino-acid cation (CHEBI:33703) |
| (3R)-3-methyl-D-ornithine(1+) (CHEBI:64642) is conjugate acid of (3R)-3-methyl-D-ornithine (CHEBI:64693) |
| Incoming Relation(s) |
| (3R)-3-methyl-D-ornithine (CHEBI:64693) is conjugate base of (3R)-3-methyl-D-ornithine(1+) (CHEBI:64642) |
| IUPAC Name |
|---|
| (2R,3R)-2,5-diazaniumyl-3-methylpentanoate |
| Synonyms | Source |
|---|---|
| (2R,3R)-3-methylornithine | SUBMITTER |
| (2R,3R)-2,5-diammonio-3-methylpentanoate | IUPAC |
| UniProt Name | Source |
|---|---|
| (3R)-3-methyl-D-ornithine | UniProt |
| Citations |
|---|