EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H26N4O3 |
| Net Charge | 0 |
| Average Mass | 274.365 |
| Monoisotopic Mass | 274.20049 |
| SMILES | C[C@H](CCN)[C@@H](N)C(=O)NCCCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C12H26N4O3/c1-8(5-6-13)10(15)11(17)16-7-3-2-4-9(14)12(18)19/h8-10H,2-7,13-15H2,1H3,(H,16,17)(H,18,19)/t8-,9+,10-/m1/s1 |
| InChIKey | PBUWDBPUDWMXGC-KXUCPTDWSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N6-[(3R)-3-methyl-D-ornithyl]-L-lysine (CHEBI:64692) is a dipeptide (CHEBI:46761) |
| N6-[(3R)-3-methyl-D-ornithyl]-L-lysine (CHEBI:64692) is conjugate base of N6-[(3R)-3-methyl-D-ornithyl]-L-lysine(2+) (CHEBI:64643) |
| Incoming Relation(s) |
| N6-[(3R)-3-methyl-D-ornithyl]-L-lysine(2+) (CHEBI:64643) is conjugate acid of N6-[(3R)-3-methyl-D-ornithyl]-L-lysine (CHEBI:64692) |
| IUPAC Name |
|---|
| N6-(5-amino-D-isoleucyl)-L-lysine |