EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H28N4O3 |
| Net Charge | +2 |
| Average Mass | 276.381 |
| Monoisotopic Mass | 276.21504 |
| SMILES | C[C@H](CC[NH3+])[C@@H]([NH3+])C(=O)NCCCC[C@H]([NH3+])C(=O)[O-] |
| InChI | InChI=1S/C12H26N4O3/c1-8(5-6-13)10(15)11(17)16-7-3-2-4-9(14)12(18)19/h8-10H,2-7,13-15H2,1H3,(H,16,17)(H,18,19)/p+2/t8-,9+,10-/m1/s1 |
| InChIKey | PBUWDBPUDWMXGC-KXUCPTDWSA-P |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N6-[(3R)-3-methyl-D-ornithyl]-L-lysine(2+) (CHEBI:64643) is a peptide cation (CHEBI:60194) |
| N6-[(3R)-3-methyl-D-ornithyl]-L-lysine(2+) (CHEBI:64643) is conjugate acid of N6-[(3R)-3-methyl-D-ornithyl]-L-lysine (CHEBI:64692) |
| Incoming Relation(s) |
| N6-[(3R)-3-methyl-D-ornithyl]-L-lysine (CHEBI:64692) is conjugate base of N6-[(3R)-3-methyl-D-ornithyl]-L-lysine(2+) (CHEBI:64643) |
| IUPAC Name |
|---|
| (2S)-2-azaniumyl-6-{[(2R,3R)-2,5-diazaniumyl-3-methylpentanoyl]amino}hexanoate |
| Synonyms | Source |
|---|---|
| (2R,3R)-3-methylornithyl-N6-lysine | SUBMITTER |
| (2S)-2-ammonio-6-{[(2R,3R)-2,5-diammonio-3-methylpentanoyl]amino}hexanoate | IUPAC |
| UniProt Name | Source |
|---|---|
| (3R)-3-methyl-D-ornithyl-N6-L-lysine | UniProt |
| Citations |
|---|