EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H24N4O11P2 |
| Net Charge | 0 |
| Average Mass | 474.300 |
| Monoisotopic Mass | 474.09168 |
| SMILES | CN(C)CCOP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](n2ccc(N)nc2=O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C13H24N4O11P2/c1-16(2)5-6-25-29(21,22)28-30(23,24)26-7-8-10(18)11(19)12(27-8)17-4-3-9(14)15-13(17)20/h3-4,8,10-12,18-19H,5-7H2,1-2H3,(H,21,22)(H,23,24)(H2,14,15,20)/t8-,10-,11-,12-/m1/s1 |
| InChIKey | FOYCPAILIPEVBT-HJQYOEGKSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| CDP-N,N-dimethylethanolamine (CHEBI:64676) has functional parent CDP-ethanolamine (CHEBI:16732) |
| CDP-N,N-dimethylethanolamine (CHEBI:64676) is a nucleotide-(amino alcohol)s (CHEBI:25604) |
| CDP-N,N-dimethylethanolamine (CHEBI:64676) is a phosphoethanolamine (CHEBI:36711) |
| CDP-N,N-dimethylethanolamine (CHEBI:64676) is conjugate acid of CDP-N,N-dimethylethanolamine(1−) (CHEBI:65117) |
| Incoming Relation(s) |
| CDP-N,N-dimethylethanolamine(1−) (CHEBI:65117) is conjugate base of CDP-N,N-dimethylethanolamine (CHEBI:64676) |
| IUPAC Name |
|---|
| 5'-O-[({[2-(dimethylamino)ethoxy](hydroxy)phosphoryl}oxy)(hydroxy)phosphoryl]cytidine |
| Synonym | Source |
|---|---|
| CDP-N-dimethylethanolamine | MetaCyc |
| Manual Xrefs | Databases |
|---|---|
| CPD4FS-1 | MetaCyc |