EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:16732 - CDP-ethanolamine
| Formula | C11H20N4O11P2 |
| Net Charge | 0 |
| Average Mass | 446.246 |
| Monoisotopic Mass | 446.06038 |
| SMILES | NCCOP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](n2ccc(N)nc2=O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C11H20N4O11P2/c12-2-4-23-27(19,20)26-28(21,22)24-5-6-8(16)9(17)10(25-6)15-3-1-7(13)14-11(15)18/h1,3,6,8-10,16-17H,2,4-5,12H2,(H,19,20)(H,21,22)(H2,13,14,18)/t6-,8-,9-,10-/m1/s1 |
| InChIKey | WVIMUEUQJFPNDK-PEBGCTIMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| CDP-ethanolamine (CHEBI:16732) has role mouse metabolite (CHEBI:75771) |
| CDP-ethanolamine (CHEBI:16732) is a nucleotide-(amino alcohol)s (CHEBI:25604) |
| CDP-ethanolamine (CHEBI:16732) is a phosphoethanolamine (CHEBI:36711) |
| CDP-ethanolamine (CHEBI:16732) is conjugate acid of CDP-ethanolamine(1−) (CHEBI:57876) |
| Incoming Relation(s) |
| CDP-N-methylethanolamine (CHEBI:15868) has functional parent CDP-ethanolamine (CHEBI:16732) |
| CDP-N,N-dimethylethanolamine (CHEBI:64676) has functional parent CDP-ethanolamine (CHEBI:16732) |
| CDP-ethanolamine(1−) (CHEBI:57876) is conjugate base of CDP-ethanolamine (CHEBI:16732) |
| IUPAC Names |
|---|
| 5'-O-[{[(2-aminoethoxy)(hydroxy)phosphoryl]oxy}(hydroxy)phosphoryl]cytidine |
| cytidine 5'-[3-(2-aminoethyl) dihydrogen diphosphate] |
| Synonyms | Source |
|---|---|
| CDP ethanolamine | ChemIDplus |
| cytidine 5'-(trihydrogen diphosphate), P'-(2-aminoethyl) ester | ChemIDplus |
| cytidine diphosphate ethanolamine | ChemIDplus |
| Cytidine diphosphate ethanolamine | KEGG COMPOUND |