EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H16INO2 |
| Net Charge | 0 |
| Average Mass | 321.158 |
| Monoisotopic Mass | 321.02258 |
| SMILES | COc1cc(CC(C)N)c(OC)cc1I |
| InChI | InChI=1S/C11H16INO2/c1-7(13)4-8-5-11(15-3)9(12)6-10(8)14-2/h5-7H,4,13H2,1-3H3 |
| InChIKey | BGMZUEKZENQUJY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | central nervous system stimulant Any drug that enhances the activity of the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-(4-iodo-2,5-dimethoxyphenyl)-1-methylethylamine (CHEBI:64629) has functional parent amphetamine (CHEBI:2679) |
| 2-(4-iodo-2,5-dimethoxyphenyl)-1-methylethylamine (CHEBI:64629) is a amphetamines (CHEBI:35338) |
| 2-(4-iodo-2,5-dimethoxyphenyl)-1-methylethylamine (CHEBI:64629) is a dimethoxybenzene (CHEBI:51681) |
| 2-(4-iodo-2,5-dimethoxyphenyl)-1-methylethylamine (CHEBI:64629) is a organoiodine compound (CHEBI:37142) |
| IUPAC Name |
|---|
| 1-(4-iodo-2,5-dimethoxyphenyl)propan-2-amine |
| Synonyms | Source |
|---|---|
| 1-(2,5-Dimethoxy-4-iodophenyl)-2-aminopropane | ChemIDplus |
| 1-(4-Iodo-2,5-dimethoxyphenyl)-2-aminopropane | ChemIDplus |
| 2,5-Dimethoxy-4-iodoamphetamine | ChemIDplus |
| 2,5-Dimethoxy-4-iodophenylisopropylamine | ChemIDplus |
| 4-DOI | ChemIDplus |
| 4-Iodo-2,5-dimethoxyphenylisopropylamine | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2727017 | Reaxys |
| CAS:64584-34-5 | ChemIDplus |