EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H14O6 |
| Net Charge | 0 |
| Average Mass | 290.271 |
| Monoisotopic Mass | 290.07904 |
| SMILES | COc1cc(O)cc2cc3c(c(O)c12)C(=O)CC(C)(O)O3 |
| InChI | InChI=1S/C15H14O6/c1-15(19)6-9(17)13-11(21-15)4-7-3-8(16)5-10(20-2)12(7)14(13)18/h3-5,16,18-19H,6H2,1-2H3 |
| InChIKey | FKCYENFBFZUSDP-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Alternaria alternata (ncbitaxon:5599) | - | PubMed (22377027) | From the culture of Alternaria alternata strain D2006, isolated from the marine soft coral Denderonephthya hemprichi Strain: D2006 |
| Aspergillus carbonarius (ncbitaxon:40993) | - | PubMed (18205129) | From the AcOEt extract Strain: WZ-4-11 |
| Aspergillus niger (ncbitaxon:5061) | - | PubMed (27245874) | From the fermentation of the marine-mudflat-derived fungus Aspergillus niger in the presence of metal bromides NaBr and CaBr2 |
| Roles Classification |
|---|
| Biological Roles: | marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fonsecin (CHEBI:64543) has role Aspergillus metabolite (CHEBI:76956) |
| fonsecin (CHEBI:64543) has role marine metabolite (CHEBI:76507) |
| fonsecin (CHEBI:64543) is a aromatic ether (CHEBI:35618) |
| fonsecin (CHEBI:64543) is a cyclic hemiketal (CHEBI:59780) |
| fonsecin (CHEBI:64543) is a heptaketide (CHEBI:59872) |
| fonsecin (CHEBI:64543) is a naphtho-γ-pyrone (CHEBI:64542) |
| fonsecin (CHEBI:64543) is a phenols (CHEBI:33853) |
| Incoming Relation(s) |
| fonsecin B (CHEBI:133825) has functional parent fonsecin (CHEBI:64543) |
| IUPAC Name |
|---|
| 2,5,8-trihydroxy-6-methoxy-2-methyl-2,3-dihydro-4H-benzo[g]chromen-4-one |
| UniProt Name | Source |
|---|---|
| fonsecin | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1257750 | Reaxys |
| CAS:3748-39-8 | ChemIDplus |
| Citations |
|---|