EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H16O6 |
| Net Charge | 0 |
| Average Mass | 304.298 |
| Monoisotopic Mass | 304.09469 |
| SMILES | COc1cc(OC)c2c(O)c3c(cc2c1)OC(C)(O)CC3=O |
| InChI | InChI=1S/C16H16O6/c1-16(19)7-10(17)14-12(22-16)5-8-4-9(20-2)6-11(21-3)13(8)15(14)18/h4-6,18-19H,7H2,1-3H3 |
| InChIKey | ZYTKFYQKQVYVMW-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Alternaria alternata (ncbitaxon:5599) | - | PubMed (22377027) | From the culture of Alternaria alternata strain D2006, isolated from the marine soft coral Denderonephthya hemprichi Strain: D2006 |
| Aspergillus carbonarius (ncbitaxon:40993) | - | PubMed (4837062) | From a mutant of Aspergillus fonsecaeus N.R.R L. 67,O 16-1, also known as Aspergillus carbonarius |
| Roles Classification |
|---|
| Biological Role: | Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fonsecin B (CHEBI:133825) has functional parent fonsecin (CHEBI:64543) |
| fonsecin B (CHEBI:133825) has role Aspergillus metabolite (CHEBI:76956) |
| fonsecin B (CHEBI:133825) is a aromatic ether (CHEBI:35618) |
| fonsecin B (CHEBI:133825) is a cyclic hemiketal (CHEBI:59780) |
| fonsecin B (CHEBI:133825) is a naphtho-γ-pyrone (CHEBI:64542) |
| fonsecin B (CHEBI:133825) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| 2,5-dihydroxy-6,8-dimethoxy-2-methyl-2,3-dihydro-4H-benzo[g]chromen-4-one |
| Synonyms | Source |
|---|---|
| 2,5-dihydroxy-6,8-dimethoxy-2-methyl-2,3-dihydro-4H-naphtho[2,3-b]pyran-4-one | ChEBI |
| 2,5-dihydroxy-6,8-dimethoxy-2-methyl-2.3-dihydrobenzo[g]chromen-4-one | ChEBI |
| fonsecin monomethyl ether | ChemIDplus |
| TMC256B2 | SUBMITTER |
| TMC 256 B2 | ChEBI |
| TMC-256B2 | ChEBI |
| UniProt Name | Source |
|---|---|
| fonsecin B | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1292349 | Reaxys |
| CAS:1856-95-7 | ChemIDplus |
| Citations |
|---|