EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | H2AsO3 |
| Net Charge | -1 |
| Average Mass | 124.935 |
| Monoisotopic Mass | 124.92254 |
| SMILES | [H][As](=O)([O-])O |
| InChI | InChI=1S/AsH3O3/c2-1(3)4/h1H,(H2,2,3,4)/p-1 |
| InChIKey | BUSBFZWLPXDYIC-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| arsonate(1−) (CHEBI:64448) is a arsenic oxoanion (CHEBI:35776) |
| arsonate(1−) (CHEBI:64448) is conjugate acid of arsonate(2−) (CHEBI:29754) |
| arsonate(1−) (CHEBI:64448) is conjugate base of arsonic acid (CHEBI:29850) |
| Incoming Relation(s) |
| arsonic acid (CHEBI:29850) is conjugate acid of arsonate(1−) (CHEBI:64448) |
| arsonate(2−) (CHEBI:29754) is conjugate base of arsonate(1−) (CHEBI:64448) |
| IUPAC Name |
|---|
| hydrogen arsonate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:15943183 | Reaxys |