EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:29850 - arsonic acid
| Formula | H3AsO3 |
| Net Charge | 0 |
| Average Mass | 125.943 |
| Monoisotopic Mass | 125.92982 |
| SMILES | [H][As](=O)(O)O |
| InChI | InChI=1S/AsH3O3/c2-1(3)4/h1H,(H2,2,3,4) |
| InChIKey | BUSBFZWLPXDYIC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | inorganic acid A Brønsted acid derived from one or more inorganic compounds. Inorganic acids (also known as mineral acids) form hydrons and conjugate base ions when dissolved in water. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| arsonic acid (CHEBI:29850) is a arsonic acids (CHEBI:50955) |
| arsonic acid (CHEBI:29850) is conjugate acid of arsonate(1−) (CHEBI:64448) |
| Incoming Relation(s) |
| organoarsonic acid (CHEBI:22638) has functional parent arsonic acid (CHEBI:29850) |
| arsonate(1−) (CHEBI:64448) is conjugate base of arsonic acid (CHEBI:29850) |
| arsonoyl group (CHEBI:29848) is substituent group from arsonic acid (CHEBI:29850) |
| IUPAC Name |
|---|
| hydridodihydroxidooxidoarsenic |
| Synonyms | Source |
|---|---|
| arsonic acid | IUPAC |
| H2AsHO3 | IUPAC |
| [AsHO(OH)2] | IUPAC |
| Registry Numbers | Sources |
|---|---|
| Gmelin:2037439 | Gmelin |