EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H28O2 |
| Net Charge | 0 |
| Average Mass | 312.453 |
| Monoisotopic Mass | 312.20893 |
| SMILES | [H][C@@]12CCC3=CC(=O)CC[C@]3([H])[C@@]1([H])CC[C@@]1(CC)[C@@]2([H])CC[C@@]1(O)C#C |
| InChI | InChI=1S/C21H28O2/c1-3-20-11-9-17-16-8-6-15(22)13-14(16)5-7-18(17)19(20)10-12-21(20,23)4-2/h2,13,16-19,23H,3,5-12H2,1H3/t16-,17+,18+,19-,20-,21-/m0/s1 |
| InChIKey | WWYNJERNGUHSAO-XUDSTZEESA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | anti-HBV agent An antiviral agent that destroys or inhibits the replication of the hepatitis B virus. anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. antiviral agent A substance that destroys or inhibits replication of viruses. progestin A synthetic progestogen. |
| Applications: | analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. female contraceptive drug A chemical substance or agent with contraceptive activity in females. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. synthetic oral contraceptive An oral contraceptive which owes its effectiveness to synthetic preparation. hypoglycemic agent A drug which lowers the blood glucose level. appetite enhancer A drug which increases appetite. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| levonorgestrel (CHEBI:6443) has role analgesic (CHEBI:35480) |
| levonorgestrel (CHEBI:6443) has role anti-HBV agent (CHEBI:64951) |
| levonorgestrel (CHEBI:6443) has role anti-HIV agent (CHEBI:64946) |
| levonorgestrel (CHEBI:6443) has role antineoplastic agent (CHEBI:35610) |
| levonorgestrel (CHEBI:6443) has role antiviral agent (CHEBI:22587) |
| levonorgestrel (CHEBI:6443) has role appetite enhancer (CHEBI:50779) |
| levonorgestrel (CHEBI:6443) has role female contraceptive drug (CHEBI:49324) |
| levonorgestrel (CHEBI:6443) has role hypoglycemic agent (CHEBI:35526) |
| levonorgestrel (CHEBI:6443) has role progestin (CHEBI:59826) |
| levonorgestrel (CHEBI:6443) has role synthetic oral contraceptive (CHEBI:49326) |
| levonorgestrel (CHEBI:6443) is a 17-ethynyl-17-hydroxy-18a-homoestr-4-en-3-one (CHEBI:231594) |
| levonorgestrel (CHEBI:6443) is a 17β-hydroxy steroid (CHEBI:35343) |
| levonorgestrel (CHEBI:6443) is enantiomer of dextronorgestrel (CHEBI:50900) |
| Incoming Relation(s) |
| norgestrel (CHEBI:7630) has part levonorgestrel (CHEBI:6443) |
| dextronorgestrel (CHEBI:50900) is enantiomer of levonorgestrel (CHEBI:6443) |
| IUPAC Name |
|---|
| 17α-ethynyl-17β-hydroxy-18a-homoestr-4-en-3-one |
| INNs | Source |
|---|---|
| levonorgestrel | WHO MedNet |
| levonorgestrel | WHO MedNet |
| lèvonorgestrel | WHO MedNet |
| levonorgestrelum | WHO MedNet |
| Synonyms | Source |
|---|---|
| (−)-13-ethyl-17-hydroxy-18,19-dinor-17α-pregn-4-en-20-yn-3-one | ChemIDplus |
| 13-ethyl-17-α-ethynyl-17-β-hydroxy-4-gonen-3-one | ChemIDplus |
| 13-ethyl-17-α-ethynylgon-4-en-17-β-ol-3-one | ChemIDplus |
| 13-β-ethyl-17α-ethynyl-17β-hydroxygon-4-en-3-one | ChemIDplus |
| 17alpha-Ethynyl-17-hydroxy-18-methylestr-4-en-3-one | ChemIDplus |
| 17alpha-Ethynyl-18-homo-19-nortestosterone | ChemIDplus |
| Brand Names | Source |
|---|---|
| Athentia next | ChEMBL |
| Emerres | ChEMBL |
| Emerres una | ChEMBL |
| Ezinelle | ChEMBL |
| Fallback solo | ChEMBL |
| Her style | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 1572 | DrugCentral |
| C08149 | KEGG COMPOUND |
| D00950 | KEGG DRUG |
| DB00367 | DrugBank |
| HMDB0014511 | HMDB |
| Levonorgestrel | Wikipedia |
| LMST02030119 | LIPID MAPS |
| LSM-5955 | LINCS |
| NOG | PDBeChem |
| US3959322 | Patent |
| Registry Numbers | Sources |
|---|---|
| Beilstein:6067808 | Beilstein |
| CAS:797-63-7 | KEGG DRUG |
| Citations |
|---|