EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H28O2 |
| Net Charge | 0 |
| Average Mass | 312.453 |
| Monoisotopic Mass | 312.20893 |
| SMILES | [H][C@@]12CCC3=CC(=O)CC[C@]3([H])[C@@]1([H])CC[C@@]1(CC)[C@@]2([H])CC[C@@]1(O)C#C |
| InChI | InChI=1S/C21H28O2/c1-3-20-11-9-17-16-8-6-15(22)13-14(16)5-7-18(17)19(20)10-12-21(20,23)4-2/h2,13,16-19,23H,3,5-12H2,1H3/t16-,17+,18+,19-,20-,21-/m0/s1 |
| InChIKey | WWYNJERNGUHSAO-XUDSTZEESA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | progestin A synthetic progestogen. |
| Applications: | female contraceptive drug A chemical substance or agent with contraceptive activity in females. synthetic oral contraceptive An oral contraceptive which owes its effectiveness to synthetic preparation. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| levonorgestrel (CHEBI:6443) has role female contraceptive drug (CHEBI:49324) |
| levonorgestrel (CHEBI:6443) has role progestin (CHEBI:59826) |
| levonorgestrel (CHEBI:6443) has role synthetic oral contraceptive (CHEBI:49326) |
| levonorgestrel (CHEBI:6443) is a 17-ethynyl-17-hydroxy-18a-homoestr-4-en-3-one (CHEBI:231594) |
| levonorgestrel (CHEBI:6443) is a 17β-hydroxy steroid (CHEBI:35343) |
| levonorgestrel (CHEBI:6443) is enantiomer of dextronorgestrel (CHEBI:50900) |
| Incoming Relation(s) |
| norgestrel (CHEBI:7630) has part levonorgestrel (CHEBI:6443) |
| dextronorgestrel (CHEBI:50900) is enantiomer of levonorgestrel (CHEBI:6443) |
| IUPAC Name |
|---|
| 17α-ethynyl-17β-hydroxy-18a-homoestr-4-en-3-one |
| INNs | Source |
|---|---|
| levonorgestrel | WHO MedNet |
| levonorgestrel | WHO MedNet |
| lèvonorgestrel | WHO MedNet |
| levonorgestrelum | WHO MedNet |
| Synonyms | Source |
|---|---|
| (−)-13-ethyl-17-hydroxy-18,19-dinor-17α-pregn-4-en-20-yn-3-one | ChemIDplus |
| 13-ethyl-17-α-ethynyl-17-β-hydroxy-4-gonen-3-one | ChemIDplus |
| 13-ethyl-17-α-ethynylgon-4-en-17-β-ol-3-one | ChemIDplus |
| 13-β-ethyl-17α-ethynyl-17β-hydroxygon-4-en-3-one | ChemIDplus |
| 17alpha-Ethynyl-17-hydroxy-18-methylestr-4-en-3-one | ChemIDplus |
| 17alpha-Ethynyl-18-homo-19-nortestosterone | ChemIDplus |
| Brand Names | Source |
|---|---|
| Jadelle | DrugBank |
| Levonelle | DrugBank |
| Levonova | DrugBank |
| Microlut | ChEBI |
| Microluton | DrugBank |
| Microval | DrugBank |
| Manual Xrefs | Databases |
|---|---|
| 1572 | DrugCentral |
| C08149 | KEGG COMPOUND |
| D00950 | KEGG DRUG |
| DB00367 | DrugBank |
| HMDB0014511 | HMDB |
| Levonorgestrel | Wikipedia |
| LMST02030119 | LIPID MAPS |
| LSM-5955 | LINCS |
| NOG | PDBeChem |
| US3959322 | Patent |
| Registry Numbers | Sources |
|---|---|
| Beilstein:6067808 | Beilstein |
| CAS:797-63-7 | KEGG DRUG |
| Citations |
|---|