EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H28O2 |
| Net Charge | 0 |
| Average Mass | 312.453 |
| Monoisotopic Mass | 312.20893 |
| SMILES | [H][C@]12CCC3=CC(=O)CC[C@@]3([H])[C@]1([H])CC[C@]1(CC)[C@]2([H])CC[C@]1(O)C#C |
| InChI | InChI=1S/C21H28O2/c1-3-20-11-9-17-16-8-6-15(22)13-14(16)5-7-18(17)19(20)10-12-21(20,23)4-2/h2,13,16-19,23H,3,5-12H2,1H3/t16-,17+,18+,19-,20-,21-/m1/s1 |
| InChIKey | WWYNJERNGUHSAO-XHCJJCCMSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dextronorgestrel (CHEBI:50900) is a 17-ethynyl-17-hydroxy-18a-homoestr-4-en-3-one (CHEBI:231594) |
| dextronorgestrel (CHEBI:50900) is a 17α-hydroxy steroid (CHEBI:35342) |
| dextronorgestrel (CHEBI:50900) is enantiomer of levonorgestrel (CHEBI:6443) |
| Incoming Relation(s) |
| norgestrel (CHEBI:7630) has part dextronorgestrel (CHEBI:50900) |
| levonorgestrel (CHEBI:6443) is enantiomer of dextronorgestrel (CHEBI:50900) |
| IUPAC Name |
|---|
| (8α,9β,10α,13α,14β)-17α-ethynyl-17β-hydroxy-18a-homoestr-4-en-3-one |
| Synonyms | Source |
|---|---|
| (8α,9β,10α,13α,14β)-13-ethyl-17-hydroxy-18,19-dinorpregn-4-en-20-yn-3-one | ChEBI |
| dextronorgestrel | ChEBI |
| (+)-norgestrel | ChEBI |
| L(+)-norgestrel | ChEBI |
| L-norgestrel | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:797-64-8 | ChEBI |
| Citations |
|---|